
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84547-61-5 |
| Catalog No. | 2A-9049067 |
| Chinese Name | 5-羟甲基-1-甲基-1H-吡唑 |
| Synonyms | (2-methylpyrazol-3-yl)methanol |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 |
| Purity | 98.00 |
| Density | 1.16 g/cm3 |
| Boiling Point | 243.6ºC at 760 mmHg |
| Melting Point | 55-59.5ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature |
| HTC | 2933199090 |
| PubChem ID | 16930569 |
| SMILES | Cn1nccc1CO |
| InChI | InChI=1S/C5H8N2O/c1-7-5(4-8)2-3-6-7/h2-3,8H,4H2,1H3 |
| InChI Key | WQFOGLYQVFBDEY-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Benzylpiperazine | 84477-71-4 | 2A-9049047 |
| 2,2-Dimethylpiperazine | 84477-72-5 | 2A-9049048 |
| 1-Cbz-3-Methylpiperazine | 84477-85-0 | 2A-9049049 |
| Ethyl 4-[[1-[(4-fluorophenyl)methyl]-1H-benzimidazol-2-yl]amino]piperidine-1-carboxylate | 84501-68-8 | 2A-9049056 |
| 4-Amino-3,5-dibromopyridine | 84539-34-4 | 2A-9049058 |
| 4-Chloro-1-methyl-1H-pyrazole-3-carboxylic acid | 84547-85-3 | 2A-9049068 |
| 7-Hydroxy-1H-indole-2-carboxylic acid | 84639-84-9 | 2A-9049091 |
| 5-Amino-3-methyl-4-isoxazolecarboxylic acid | 84661-50-7 | 2A-9049095 |
| 4-(Piperazino)indole | 84807-09-0 | 2A-9049122 |
| 8-Bromo-6-methylquinoline | 84839-95-2 | 2A-9049123 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA