
CAS Number84476-99-3
SynonymsPyridine,2,5-difluoro; MFCD04114191; 2,5-Difluoropyridine; 2,4-DIFLUOROPHENYL ISOTHIOCYANATE; 2,5-difluoro-pyridine
Molecular FormulaC5H3F2N
Molecular Weight149.53
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point113.1±20.0 °C at 760 mmHg
Melting Point-33 °C
AppearanceLiquid;Colorless to Light yellow clear liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84476-99-3 |
| Catalog No. | 2A-9049045 |
| Chinese Name | 2,5-二氟吡啶 |
| Synonyms | Pyridine,2,5-difluoro; MFCD04114191; 2,5-Difluoropyridine; 2,4-DIFLUOROPHENYL ISOTHIOCYANATE; 2,5-difluoro-pyridine |
| Molecular Formula | C5H3F2N |
| Molecular Weight | 149.53 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 113.1±20.0 °C at 760 mmHg |
| Melting Point | -33 °C |
| Appearance | Liquid;Colorless to Light yellow clear liquid |
| Storage Condition | Room temperature. |
| Packaging | III |
| HTC | 2933399090 |
| PubChem ID | 3191121 |
| SMILES | Fc1ccc(F)nc1 |
| InChI | InChI=1S/C5H3F2N/c6-4-1-2-5(7)8-3-4/h1-3H |
| InChI Key | XFAMUOYNXFXQTC-UHFFFAOYSA-N |
| Hazard Symbols | Category 3 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1993 Proper shipping name: Flammable Liquid, not otherwise specified Packing grade: III |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Amino-4-bromopyridine | 84249-14-9 | 2A-9049016 |
| N-(4-Bromophenyl)-3-pyridinemethanamine | 84324-68-5 | 2A-9049022 |
| 3-(2-Aminoethyl)pyridine hydrochloride | 84359-16-0 | 2A-9049027 |
| 4-Nitro-2H-1,2,3-triazole | 84406-63-3 | 2A-9049035 |
| 2-[4-(Benzoyloxy)phenyl]benzo[b]thiophene-6-ol 6-benzoate | 84449-64-9 | 2A-9049039 |
| 2,3,4-Trifluoropyridine | 84477-04-3 | 2A-9049046 |
| 2-Benzylpiperazine | 84477-71-4 | 2A-9049047 |
| 2,2-Dimethylpiperazine | 84477-72-5 | 2A-9049048 |
| 1-Cbz-3-Methylpiperazine | 84477-85-0 | 2A-9049049 |
| Ethyl 4-[[1-[(4-fluorophenyl)methyl]-1H-benzimidazol-2-yl]amino]piperidine-1-carboxylate | 84501-68-8 | 2A-9049056 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA