
CAS Number61203-99-4
SynonymsEINECS 262-654-5; 4-(trans-4-Propylcyclohexyl)benzonitrile; trans-4-Propyl(4-cyanophenyl)cyclohexane; trans-4-(4-Propylcyclohexyl)benzonitrile; MFCD04038799; 4-(4-Propylcyclohexyl)benzonitrile
Molecular FormulaC16H21N
Molecular Weight227.345
Purity99.5%
Density1.0±0.1 g/cm3
Boiling Point351.8±21.0 °C at 760 mmHg
Melting Point45ºC
AppearanceSolid;White to Almost white powder to lump
EINECS262-654-5
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61203-99-4 |
| Catalog No. | 2A-9004898 |
| Chinese Name | 反式-4-(4-丙基环己基)苯腈 |
| Synonyms | EINECS 262-654-5; 4-(trans-4-Propylcyclohexyl)benzonitrile; trans-4-Propyl(4-cyanophenyl)cyclohexane; trans-4-(4-Propylcyclohexyl)benzonitrile; MFCD04038799; 4-(4-Propylcyclohexyl)benzonitrile |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.345 |
| Purity | 99.5 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 351.8±21.0 °C at 760 mmHg |
| Melting Point | 45ºC |
| Appearance | Solid;White to Almost white powder to lump |
| Water Solubility | Soluble in: methanol |
| Storage Condition | 2~8°C |
| EINECS | 262-654-5 |
| HTC | 2926909090 |
| SMILES | CCCC1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C16H21N/c1-2-3-13-4-8-15(9-5-13)16-10-6-14(12-17)7-11-16/h6-7,10-11,13,15H,2-5,8-9H2,1H3 |
| InChI Key | XXUSEPRYHRDKFV-UHFFFAOYSA-N |
| MSDS | msds/4898_1_61203_99_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(trans-4'-n-Pentylcyclohexyl)benzonitrile | 61204-01-1 | 2A-9004893 |
| 4-(trans-4-n-Pentylcyclohexyl)biphenyl-4'-carbonitrile | 68065-81-6 | 2A-9004894 |
| 4-(trans-4-n-Pentylcyclohexyl)phenol | 82575-69-7 | 2A-9004895 |
| 4'-(trans-4-n-Propylcyclohexyl)acetophenone | 78531-61-0 | 2A-9004896 |
| 4-(trans-4-n-Propylcyclohexyl)benzoic acid | 65355-29-5 | 2A-9004897 |
| 4-(trans-4-n-Propylcyclohexyl)biphenyl-4'-carbonitrile | 94412-40-5 | 2A-9004899 |
| 4-(trans-4-n-Propylcyclohexyl)phenol | 81936-33-6 | 2A-9004900 |
| 4'-(Trifluoromethoxy)acetophenone | 85013-98-5 | 2A-9004901 |
| 4-(Trifluoromethoxy)benzoic acid | 330-12-1 | 2A-9004903 |
| 4-(Trifluoromethoxy)benzonitrile | 332-25-2 | 2A-9004904 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA