
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 65355-30-8 |
| Catalog No. | 2A-9004892 |
| Chinese Name | 4-(反-4-戊基环己基)苯甲酸 |
| Synonyms | 4-(4-Pentylcyclohexyl)benzoic acid; MFCD06208360; 4-(trans-4-Pentylcyclohexyl)benzoic acid |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.398 |
| Purity | 99.5 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 410.5±24.0 °C at 760 mmHg |
| Melting Point | 179.0 and le 183.0 deg-C |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2916399090 |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)O)cc2)CC1 |
| InChI Key | YXKKMVGGPRVHIL-UHFFFAOYSA-N |
| MSDS | msds/4892_1_65355_30_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(trans-4-Ethylcyclohexyl)benzoic acid | 87592-41-4 | 2A-9004886 |
| 4-(trans-4-Ethylcyclohexyl)phenol | 89100-78-2 | 2A-9004887 |
| 4'-(trans-4-n-Butylcyclohexyl)acetophenone | 83626-30-6 | 2A-9004888 |
| 4-(trans-4-n-Butylcyclohexyl)benzoic acid | 83626-35-1 | 2A-9004889 |
| 4-(trans-4-n-Butylcyclohexyl)phenol | 88581-00-4 | 2A-9004890 |
| 4-(trans-4'-n-Pentylcyclohexyl)benzonitrile | 61204-01-1 | 2A-9004893 |
| 4-(trans-4-n-Pentylcyclohexyl)biphenyl-4'-carbonitrile | 68065-81-6 | 2A-9004894 |
| 4-(trans-4-n-Pentylcyclohexyl)phenol | 82575-69-7 | 2A-9004895 |
| 4'-(trans-4-n-Propylcyclohexyl)acetophenone | 78531-61-0 | 2A-9004896 |
| 4-(trans-4-n-Propylcyclohexyl)benzoic acid | 65355-29-5 | 2A-9004897 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA