
CAS Number82964-04-3
Synonyms[(6-Methoxy-5-trifluoromethyl-naphthalene-1-carbothioyl)-methyl-amino]-acetic acid; 2-[[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbothioyl]-methylamino]acetic acid; N-{[6-Methoxy-5-(trifluoromethyl)-1-naphthyl]carbothioyl}-N-methylglycine; N-{[6-Methoxy-5-(trifluoromethyl)-1-naphthyl]carbonothioyl}-N-methylglycine; N-[[6-Methoxy-5-(trifluoromethyl)-1-naphthalenyl]thioxomethyl]-N-methylglycine; AY-27,773; Tolrestatum [Latin]; N-(6-Methoxythio-5-(trifluoromethyl)-1-naphthoyl)sarcosine; Alredase; N-{[6-methoxy-5-(trifluoromethyl)naphthalen-1-yl]carbothioyl}-N-methylglycine; Tolrestatum; Tolrestat
Molecular FormulaC16H14F3NO3S
Molecular Weight357.35
Purity≥98 (HPLC)%
Density1.4±0.1 g/cm3
Boiling Point498.1±55.0 °C at 760 mmHg
Melting Point164-165°
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 82964-04-3 |
| Catalog No. | 2A-9048836 |
| Chinese Name | 托雷斯萘 |
| Synonyms | [(6-Methoxy-5-trifluoromethyl-naphthalene-1-carbothioyl)-methyl-amino]-acetic acid; 2-[[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbothioyl]-methylamino]acetic acid; N-{[6-Methoxy-5-(trifluoromethyl)-1-naphthyl]carbothioyl}-N-methylglycine; N-{[6-Methoxy-5-(trifluoromethyl)-1-naphthyl]carbonothioyl}-N-methylglycine; N-[[6-Methoxy-5-(trifluoromethyl)-1-naphthalenyl]thioxomethyl]-N-methylglycine; AY-27,773; Tolrestatum [Latin]; N-(6-Methoxythio-5-(trifluoromethyl)-1-naphthoyl)sarcosine; Alredase; N-{[6-methoxy-5-(trifluoromethyl)naphthalen-1-yl]carbothioyl}-N-methylglycine; Tolrestatum; Tolrestat |
| Molecular Formula | C16H14F3NO3S |
| Molecular Weight | 357.35 |
| Purity | ≥98 (HPLC) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 498.1±55.0 °C at 760 mmHg |
| Melting Point | 164-165° |
| Appearance | powder |
| Storage Condition | 2-8℃ |
| Application | Tolrestat is a potent, orally available aldose reductase inhibitor with an IC50 of 35 nM. |
| PubChem ID | 4773 |
| SMILES | FC(F)(F)c1c2c(c(ccc2)C(=S)N(CC(=O)O)C)ccc1OC |
| InChI | 1S/C16H14F3NO3S/c1-20(8-13(21)22)15(24)11-5-3-4-10-9(11)6-7-12(23-2)14(10)16(17,18)19/h3-7H,8H2,1-2H3,(H,21,22) |
| InChI Key | LUBHDINQXIHVLS-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/48836_1_82964_04_3.pdf |
| Transport Info | Product Name: Tolrestat |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 1,2,2,6,6-pentamethyl-4-piperidyl sebacate | 82919-37-7 | 2A-9048828 |
| 4-Cumylphenhyl chloroformate | 82941-10-4 | 2A-9048829 |
| Trimetrexate glucuronate | 82952-64-5 | 2A-9048830 |
| 6-Amidino-2-naphthol methanesulfonate | 82957-06-0 | 2A-9048833 |
| 2-Methyl-3-chlorothioanisole | 82961-52-2 | 2A-9048834 |
| Bis(trimethoxysilylpropyl)amine | 82985-35-1 | 2A-9048837 |
| 5-(1,1-Dimethylheptyl)-2-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]phenol | 83002-04-4 | 2A-9048839 |
| 7,7a-Dihydro-2,2,4,6,6-pentamethyl-1,3-benzodioxol-5(6H)-one | 83020-74-0 | 2A-9048842 |
| 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-D-galactose | 83025-10-9 | 2A-9048843 |
| Pyridinium fluorochromate | 83042-08-4 | 2A-9048845 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA