
CAS Number82832-27-7
Synonyms4-(4-Fluoro-phenyl)-4'-propyl-bicyclohexyl; trans-1-p-fluorophenyl-4-(trans-4-propylcyclohexyl)-cyclohexane; trans,trans-4-(4-Fluorophenyl)-4'-propylbicyclohexyl; trans-4-n-propyl-trans-4'-(4-fluorophenyl)bicyclohexane
Molecular FormulaC21H31F1
Molecular Weight302.48
Purity98.00%
Melting Point71 °C
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 82832-27-7 |
| Catalog No. | 2A-9048812 |
| Chinese Name | 反,反-4-(4-氟苯基)-4'-丙基联二环己烷 |
| Synonyms | 4-(4-Fluoro-phenyl)-4'-propyl-bicyclohexyl; trans-1-p-fluorophenyl-4-(trans-4-propylcyclohexyl)-cyclohexane; trans,trans-4-(4-Fluorophenyl)-4'-propylbicyclohexyl; trans-4-n-propyl-trans-4'-(4-fluorophenyl)bicyclohexane |
| Molecular Formula | C21H31F1 |
| Molecular Weight | 302.48 |
| Purity | 98.00 |
| Melting Point | 71 °C |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2903999090 |
| PubChem ID | 3919605 |
| MDL Number | MFCD09838996 |
| SMILES | CCCC1CCC(C2CCC(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H31F/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-14-21(22)15-13-20/h12-19H,2-11H2,1H3 |
| InChI Key | IKODGORUTZMKPL-UHFFFAOYSA-N |
| MSDS | msds/48812_1_82832_27_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methoxy-2-nitro-1-(phenylmethoxy)benzene | 82780-78-7 | 2A-9048803 |
| (-)-2-Amino-4-phenylbutyric acid | 82795-51-5 | 2A-9048804 |
| 3,4-Methylenedioxy-N-ethylamphetamine | 82801-81-8 | 2A-9048808 |
| Mabuprofen | 82821-47-4 | 2A-9048810 |
| DOI hydrochloride | 82830-44-2 | 2A-9048811 |
| trans,trans-4-(3,4-Difluorophenyl)-4''-propylbicyclohexyl | 82832-57-3 | 2A-9048813 |
| trans,trans-4-(3,4-Difluorophenyl)-4''-butylbicyclohexyl | 82832-58-4 | 2A-9048814 |
| trans-4-(trans-4-Propylcyclohexyl)cyclohexanol | 82832-72-2 | 2A-9048815 |
| 4-Propyldicyclohexylanone | 82832-73-3 | 2A-9048816 |
| 3-Bromo-2,4,6-trimethylaniline | 82842-52-2 | 2A-9048819 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA