
CAS Number82769-76-4
Synonyms(3S)-3-Amino-3-phenyl-1-propanol; (3S)-3-Amino-3-phenylpropan-1-ol; 3-Amino-3-phenyl-1-propanol; MFCD01311768; 3-Amino-3-phenyl-propan-1-ol; 3-amino-3-phenylpropan-1-ol
Molecular FormulaC9H13NO
Molecular Weight151.21
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point293.0±20.0 °C at 760 mmHg
Melting Point69 °C
Appearancecolorless viscous liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 82769-76-4 |
| Catalog No. | 2A-9048800 |
| Chinese Name | (S)-3-氨基-3-苯基丙醇 |
| Synonyms | (3S)-3-Amino-3-phenyl-1-propanol; (3S)-3-Amino-3-phenylpropan-1-ol; 3-Amino-3-phenyl-1-propanol; MFCD01311768; 3-Amino-3-phenyl-propan-1-ol; 3-amino-3-phenylpropan-1-ol |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 293.0±20.0 °C at 760 mmHg |
| Melting Point | 69 °C |
| Appearance | colorless viscous liquid |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2922199090 |
| PubChem ID | 3155382 |
| SMILES | NC(CCO)c1ccccc1 |
| InChI | InChI=1S/C9H13NO/c10-9(6-7-11)8-4-2-1-3-5-8/h1-5,9,11H,6-7,10H2/t9-/m0/s1 |
| InChI Key | SEQXIQNPMQTBGN-VIFPVBQESA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (S)-N-Boc-3-Bromophenylalanine | 82278-73-7 | 2A-9048721 |
| (R)-Isopropyloxirane | 82378-47-0 | 2A-9048731 |
| Poly[N,N'-bis(2,2,6,6-tetramethyl-4-piperidinyl)-1,6-hexanediamine-co-2,4-dichloro-6-morpholino-1,3,5-triazine] | 82451-48-7 | 2A-9048746 |
| (S)-2-[(S)-2-((S)-1-Ethoxycarbonyl-3-phenylpropylamino)propionyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid benzyl ester | 82637-57-8 | 2A-9048782 |
| (S)-3-Dimethylamino-3-phenylpropanol | 82769-75-3 | 2A-9048799 |
| (S)-1-(3-Methoxyphenyl)ethylamine | 82796-69-8 | 2A-9048806 |
| 8-(Phenylmethyl)-8-azabicyclo[3.2.1]octan-3-one hydrochloride | 83393-23-1 | 2A-9048877 |
| 3-Benzyl-3-azabicyclo[3.2.1]octan-8-one | 83507-33-9 | 2A-9048898 |
| N-Cbz-hexahydro-1H-azepin-4-one | 83621-33-4 | 2A-9048910 |
| (R)-2-Methylaziridine | 83647-99-8 | 2A-9048915 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA