
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 82668-50-6 |
| Catalog No. | 2A-9048787 |
| Chinese Name | (1H-吡唑-3-基)乙酸乙酯 |
| Synonyms | AC-6393; 1H-Pyrazole-3-aceticacid,ethyl ester |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.16600 |
| Purity | 98.00 |
| Density | 1.183 g/cm3 |
| Boiling Point | 289.5ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933199090 |
| PubChem ID | 92722287 |
| SMILES | CCOC(=O)Cc1ccn[nH]1 |
| InChI | InChI=1S/C7H10N2O2/c1-2-11-7(10)5-6-3-4-8-9-6/h3-4H,2,5H2,1H3,(H,8,9) |
| InChI Key | MZLKPCAZQWMXFD-UHFFFAOYSA-N |
| MSDS | msds/48787_1_82668_50_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Ethyl-N-(3-sulfopropyl)aniline sodium salt | 82611-85-6 | 2A-9048778 |
| N-Ethyl-N-(3-sulfopropyl)-3-methoxyaniline sodium salt | 82611-88-9 | 2A-9048779 |
| Bismuth tris(methanesulfonate) | 82617-81-0 | 2A-9048780 |
| L-Threonine hydrochloride | 82650-07-5 | 2A-9048784 |
| Vanillyl butyl ether | 82654-98-6 | 2A-9048785 |
| N-(2-Hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium salt | 82692-88-4 | 2A-9048791 |
| Sodium 3-(N-ethyl-3-methylanilino)-2-hydroxypropanesulfonate | 82692-93-1 | 2A-9048792 |
| N-Ethyl-N-(2-hydroxy-3-sulfopropyl)-3-methoxyaniline sodium salt dihydrate | 82692-96-4 | 2A-9048793 |
| N-Ethyl-N-(2-hydroxy-3-sulfopropyl)-3,5-dimethylaniline sodium salt monohydrate | 82692-97-5 | 2A-9048794 |
| 3-Fluoro-6-nitrobenzenesulfonic acid | 82711-99-7 | 2A-9048795 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA