
CAS Number54997-92-1
Synonyms4-n-butylphenylsulfonyl chloride; 4-(butyl)benzenesulfonyl chloride; (4-butylphenyl)chlorosulfone; p-butylbenzenesulfonyl chloride; MFCD00173908; 4-Butylbenzenesulfonyl chloride; 4-n-butylbenzenesulphonyl chloride; 4-butylbenzene-1-sulfonyl chloride; 4-n-butylbenzenesulfonyl chloride
Molecular FormulaC21H34ClNO3
Molecular Weight383.963
Purity97%
Density1.2±0.1 g/cm3
Boiling Point310.1±21.0 °C at 760 mmHg
Melting Point13-15°C
Appearanceliquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54997-92-1 |
| Catalog No. | 2A-9004877 |
| Chinese Name | 4-丁苯-1-磺酰氯 |
| Synonyms | 4-n-butylphenylsulfonyl chloride; 4-(butyl)benzenesulfonyl chloride; (4-butylphenyl)chlorosulfone; p-butylbenzenesulfonyl chloride; MFCD00173908; 4-Butylbenzenesulfonyl chloride; 4-n-butylbenzenesulphonyl chloride; 4-butylbenzene-1-sulfonyl chloride; 4-n-butylbenzenesulfonyl chloride |
| Molecular Formula | C21H34ClNO3 |
| Molecular Weight | 383.963 |
| Purity | 97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 310.1±21.0 °C at 760 mmHg |
| Melting Point | 13-15°C |
| Appearance | liquid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | II |
| HTC | 2904909090 |
| MDL Number | MFCD06795721 |
| SMILES | CCCCc1ccc(S(=O)(=O)Cl)cc1 |
| InChI Key | OVFZELSNOHIDEF-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Risk Codes | R14;R29;R34 |
| Safety Description | S22;S26;S30;S36/37/39;S45;S8 |
| MSDS | msds/4877_1_54997_92_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(Methylsulfonyl)benzyl chloride | 40517-43-9 | 2A-9004867 |
| 4-(Methylsulphonyl)acetophenone | 10297-73-1 | 2A-9004868 |
| 4-(Methylsulphonyl)aniline | 5470-49-5 | 2A-9004869 |
| 4-(Methylthio)acetophenone | 1778-09-2 | 2A-9004870 |
| 4-(N,N-Dimethyamino)cinnamic acid | 1552-96-1 | 2A-9004874 |
| 4-(N-Ethyl-N-2-methanesulfonylaminoethyl)-2-methylphenylenediamine; CD-3 | 25646-71-3 | 2A-9004878 |
| 4-(Nicotinamido)butanoic acid | 34562-97-5 | 2A-9004879 |
| 4-(tert-Butyl)-2,6-dimethylaniline | 42014-60-8 | 2A-9004881 |
| 4-(tert-Butyl)-2-nitroaniline | 6310-19-6 | 2A-9004882 |
| 4-(tert-Butyl)cinnamic acid | 1208-65-7 | 2A-9004884 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA