CAS Number81907-61-1
SynonymsGanoderic acid β; Ganoderic acid A; (7|A,15|A,25r)-7,15-dihydroxy-3,11,23-trioxolanost-8-en-26-oic acid; (3β,7β,25R)-3,7-Dihydroxy-11,15,23-trioxolanost-8-en-26-oic acid; ganoderic acid B; Ganoderic acid; (3β,7β)-3,7-Dihydroxy-11,15,23-trioxolanost-8-en-26-oic acid; 24,25-Dihydrolanosterol
Molecular FormulaC30H44O7
Molecular Weight516.67
Purity≥95.0 (HPLC)%
Density1.2±0.1 g/cm3
Boiling Point689.0±55.0 °C at 760 mmHg
Appearancesolid
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81907-61-1 |
| Catalog No. | 2A-9048674 |
| Chinese Name | 灵芝酸B |
| Synonyms | Ganoderic acid β; Ganoderic acid A; (7|A,15|A,25r)-7,15-dihydroxy-3,11,23-trioxolanost-8-en-26-oic acid; (3β,7β,25R)-3,7-Dihydroxy-11,15,23-trioxolanost-8-en-26-oic acid; ganoderic acid B; Ganoderic acid; (3β,7β)-3,7-Dihydroxy-11,15,23-trioxolanost-8-en-26-oic acid; 24,25-Dihydrolanosterol |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.67 |
| Purity | ≥95.0 (HPLC) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 689.0±55.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | -20C |
| Application | Ganoderic acid B is a triterpene compound isolated from Ganoderma lucidum. Ganoderic acid B acts as a telomerase inhibitor to inhibit the activation of Epstein-Barr virus (EBV) antigens. Ganoderic aci |
| PubChem ID | 626105 |
| MDL Number | MFCD09752803 |
| SMILES | O[C@@H]1C([C@H]2[C@](CC1)(C3=C([C@]4([C@@]([C@H](CC4=O)[C@@H](CC(=O)C[C@@H](C)C(=O)O)C)(CC3=O)C)C)[C@H](C2)O)C)(C)C |
| InChI | 1S/C30H44O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18-19,21-22,32,34H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,19+,21+,22+,28+,29-,30+/m1/s1 |
| InChI Key | LWPLEHFGBRFRKI-NBCWKOIPSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/48674_1_81907_61_1.pdf |
| Transport Info | Product Name: Ganoderma Acid B |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-5-fluorobenzyl bromide | 81778-09-8 | 2A-9048663 |
| 4-Methyl-3-decen-5-ol | 81782-77-6 | 2A-9048664 |
| trans-4-Fluoro-4'-(4-methylcyclohexyl)-1,1'-biphenyl | 81793-56-8 | 2A-9048665 |
| Quinocetone | 81810-66-4 | 2A-9048666 |
| Polyquaternium-10 | 81859-24-7 | 2A-9048669 |
| UREA-15N2 | 2067-80-3 | 2A-9048675 |
| Bendazac L-lysine | 81919-14-4 | 2A-9048676 |
| 5-Methyl-2-hepten-4-one | 81925-81-7 | 2A-9048677 |
| 4-Heptylphenyl 4-(trans-4-propylcyclohexyl)benzoate | 81929-42-2 | 2A-9048678 |
| 4-Butylphenyl 4-(trans-4-pentylcyclohexyl)benzoate | 81929-43-3 | 2A-9048679 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS