
CAS Number722-92-9
Synonyms4-(1-Hydroxy-1-trifluoromethyl-2,2,2-trifluoroethyl)aniline; 2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol; MFCD00039258; 2-(4-Aminophenyl)-1,1,1,3,3,3-hexafluoro-2-propanol
Molecular FormulaC9H7F6NO
Molecular Weight259.148
Purity97%
Density1.5±0.1 g/cm3
Boiling Point292.9±40.0 °C at 760 mmHg
Melting Point155-157ºC
AppearanceLight brown crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 722-92-9 |
| Catalog No. | 2A-9004865 |
| Chinese Name | 4-(六氟-2-羟基异丙基)苯胺 |
| Synonyms | 4-(1-Hydroxy-1-trifluoromethyl-2,2,2-trifluoroethyl)aniline; 2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol; MFCD00039258; 2-(4-Aminophenyl)-1,1,1,3,3,3-hexafluoro-2-propanol |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.148 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 292.9±40.0 °C at 760 mmHg |
| Melting Point | 155-157ºC |
| Appearance | Light brown crystalline powder |
| Storage Condition | Keep container tightly closed and stored in a cool |
| HTC | 2922199090 |
| SMILES | Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F6NO/c10-8(11,12)7(17,9(13,14)15)5-1-3-6(16)4-2-5/h1-4,17H,16H2 |
| InChI Key | TZEJXCIGVMTMDY-UHFFFAOYSA-N |
| MSDS | msds/4865_1_722_92_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(Difluoromethoxy)bromobenzene | 5905-69-1 | 2A-9004857 |
| 4-(Difluoromethoxy)iodobenzene | 128140-82-9 | 2A-9004858 |
| 4-(Difluoromethoxy)phenacyl bromide | 141134-24-9 | 2A-9004859 |
| 4-(Difluoromethoxy)phenylacetonitrile | 41429-16-7 | 2A-9004860 |
| 4-(Diisopropylamino)-2-phenyl-2-(pyridin-2-yl)butanenitrile | 5005-46-9 | 2A-9004862 |
| 4-(Imidazol-1-yl)acetophenone | 10041-06-2 | 2A-9004866 |
| 4-(Methylsulfonyl)benzyl chloride | 40517-43-9 | 2A-9004867 |
| 4-(Methylsulphonyl)acetophenone | 10297-73-1 | 2A-9004868 |
| 4-(Methylsulphonyl)aniline | 5470-49-5 | 2A-9004869 |
| 4-(Methylthio)acetophenone | 1778-09-2 | 2A-9004870 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA