
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81453-98-7 |
| Catalog No. | 2A-9048625 |
| Chinese Name | 3-乙酰-1-(苯磺酰基)吡咯 |
| Synonyms | MFCD00067752; 1-[1-(benzenesulfonyl)pyrrol-3-yl]ethanone |
| Molecular Formula | C10H8O2N1Br1S1 |
| Molecular Weight | 286.15 |
| Purity | 98.00 |
| Density | 1.26g/cm3 |
| Boiling Point | 435.7ºC at 760mmHg |
| Melting Point | 96-99 °C(lit.) |
| Appearance | Beige crystalline powder |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2933990090 |
| PubChem ID | 3140727 |
| MDL Number | MFCD13186766 |
| SMILES | CC(=O)c1ccn(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C12H11NO3S/c1-10(14)11-7-8-13(9-11)17(15,16)12-5-3-2-4-6-12/h2-9H,1H3 |
| InChI Key | HTMLKRFQINMFRA-UHFFFAOYSA-N |
| MSDS | msds/48625_1_81453_98_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Tetrahydrofuran-2-carboxylic acid (3-methylaminopropyl)amide | 81403-67-0 | 2A-9048614 |
| 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-benzamide compound with piperazine (2:1) | 81424-66-0 | 2A-9048621 |
| Ethyl 2-chlorothiazole-5-carboxylate | 81449-93-6 | 2A-9048622 |
| 1-(Isopropyldimethylsilyl)imidazole | 81452-04-2 | 2A-9048623 |
| Methyl 3-methylthiophene-2-carboxylate | 81452-54-2 | 2A-9048624 |
| 2,3-Dimethyl-5-(trifluoromethyl)-1H-indole | 81558-19-2 | 2A-9048634 |
| 3-Chloro-4-(trifluoromethyl)pyridine | 81565-19-7 | 2A-9048637 |
| 4,5-Dibromothiophene-2-sulphonyl chloride | 81606-31-7 | 2A-9048640 |
| 5-Chloroindole-3-acetonitrile | 81630-83-3 | 2A-9048642 |
| tert-Butyl (2S)-2-(hydroxymethyl)-5-oxopyrrolidine-1-carboxylate | 81658-25-5 | 2A-9048644 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA