
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80793-25-5 |
| Catalog No. | 2A-9048530 |
| Chinese Name | 3-(4-溴苯基)丙醛 |
| Synonyms | 3-(4-bromophenyl)propanal |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07100 |
| Purity | 98.00 |
| Density | 1.399 g/cm3 |
| Boiling Point | 267.8ºC at 760 mmHg |
| Storage Condition | -20°C, protected from light and stored in inert ga |
| HTC | 2913000090 |
| PubChem ID | 16582459 |
| SMILES | O=CCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H9BrO/c10-9-5-3-8(4-6-9)2-1-7-11/h3-7H,1-2H2 |
| InChI Key | RXZJWVPNFPPSEM-UHFFFAOYSA-N |
| MSDS | msds/48530_1_80793_25_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Aminophenylboronic acid hydrochloride | 80460-73-7 | 2A-9048482 |
| 4-Methyl-3-nitrophenylboronic acid | 80500-27-2 | 2A-9048489 |
| 2-(4-Chloromethylphenyl)propionic acid | 80530-55-8 | 2A-9048494 |
| 4'-Chlorobiphenyl-4-carbaldehyde | 80565-30-6 | 2A-9048499 |
| 4-Bromomethyl-5-methyl-1,3-dioxol-2-one | 80715-22-6 | 2A-9048521 |
| Tributyltin hydroxide | 80883-02-9 | 2A-9048541 |
| (Trifluoromethyl)trimethylsilane | 81290-20-2 | 2A-9048600 |
| BENZYLOXYACETALDEHYDE | 60656-87-3 | 2A-9048619 |
| 2-Hydroxy-1,3,5-benzenetricarbaldehyde | 81502-74-1 | 2A-9048631 |
| Balsalazide disodium | 82101-18-6 | 2A-9048700 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA