
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80681-45-4 |
| Catalog No. | 2A-9048516 |
| Chinese Name | 升麻素苷 |
| Synonyms | HMS2196A10; N1606; Prim-O-glucosylcimifugin |
| Molecular Formula | C22H28O11 |
| Molecular Weight | 468.45 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 736.9±60.0 °C at 760 mmHg |
| Melting Point | 120 °C |
| Appearance | solid |
| Storage Condition | <0°C; avoid heating |
| Application | Prim-O-glucosylcimifugin has potent anti-inflammatory effects. Inhibition of iNOS and COX-2 expression via modulation of JAK2/STAT3 signaling. |
| HTC | 29389090 |
| PubChem ID | 69926663 |
| SMILES | COc1c2c(cc3oc(COC4OC(CO)C(O)C(O)C4O)cc(=O)c13)OC(C(C)(C)O)C2 |
| InChI | 1S/C22H28O11/c1-22(2,28)15-5-10-12(32-15)6-13-16(20(10)29-3)11(24)4-9(31-13)8-30-21-19(27)18(26)17(25)14(7-23)33-21/h4,6,14-15,17-19,21,23,25-28H,5,7-8H2,1-3H3/t14-,15+,17-,18+,19-,21-/m1/s1 |
| InChI Key | XIUVHOSBSDYXRG-UVTAEQIVSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/48516_1_80681_45_4.pdf |
| Transport Info | Product name: Cimicifugarin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Edatrexate | 80576-83-6 | 2A-9048504 |
| Tetraphenyl dipropyleneglycol diphosphite | 80584-85-6 | 2A-9048505 |
| Poly(dipropyleneglycol)phenyl phosphite | 80584-86-7 | 2A-9048506 |
| Leu-Enkephalin (sulfated) | 80632-52-6 | 2A-9048511 |
| 4-(3-Pyridinyloxy)phenylamine | 80650-45-9 | 2A-9048512 |
| 6-Methoxy-4-methyl-2(3H)-benzothiazolone | 80689-16-3 | 2A-9048517 |
| 2-Perfluorobutylethyl acetate | 80705-15-3 | 2A-9048519 |
| 1-Phenylpiperidin-3-ol | 80710-25-4 | 2A-0200700 |
| (aS)-a-[[(1S)-1-Carboxyethyl]amino]benzenebutanoic acid 1-ethyl ester hydrochloride | 80828-26-8 | 2A-9048533 |
| 4-Cloromethyl-5-methyl-1,3-dioxol-2-one | 80841-78-7 | 2A-9048535 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA