| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79455-63-3 |
| Catalog No. | 2A-9048341 |
| Chinese Name | 2-氯-6-氟苯甲酰氯 |
| Synonyms | MFCD00178746; GVR BG FF; EINECS 279-162-1; 2-Chloro-6-fluorobenzoyl chloride |
| Molecular Formula | C7H3Cl2FO |
| Molecular Weight | 193 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 213.9±20.0 °C at 760 mmHg |
| Melting Point | 57ºC |
| Storage Condition | Store in a container filled with dry inert gas and |
| Packaging | II |
| HTC | 2916399090 |
| PubChem ID | 3159693 |
| SMILES | O=C(Cl)c1c(F)cccc1Cl |
| InChI | InChI=1S/C7H3Cl2FO/c8-4-2-1-3-5(10)6(4)7(9)11/h1-3H |
| InChI Key | GFNAJZAKJGKJCS-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3265 Proper shipping name: Corrosive Liquid, Acidic, Organic, Not Otherwise Specified Packing grade: II |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 4,6-dihydroxynicotinate | 79398-27-9 | 2A-9048335 |
| Echinocandin B | 79411-15-7 | 2A-9048336 |
| 1-Aminopiperidin-4-ol | 79414-82-7 | 2A-9048337 |
| 5-Aminolevulinic acid methyl ester hydrochloride | 79416-27-6 | 2A-9048338 |
| 2-Amino-2-(3-bromophenyl)acetic acid | 79422-73-4 | 2A-9048339 |
| Eleutheroside D | 79484-75-6 | 2A-9048344 |
| 2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol | 79538-03-7 | 2A-9048350 |
| Ferene disodium salt | 79551-14-7 | 2A-9048355 |
| 5-Hydroxy-7-(4''-hydroxy-3''-methoxyphenyl)-1-phenyl-3-heptanone | 79559-61-8 | 2A-9048356 |
| 4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenimine | 79560-20-6 | 2A-9048359 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS