
CAS Number79002-39-4
Synonyms5-cyanobenzo(b)furan; CYANOBENZOFURAN; 5-cyano-1-benzofuran; 5-Benzofurancarbonitrile; Benzofuran-5-carbonitrile; 5-CYANO-BENZOFURAN; 1-Benzofuran-5-carbonitrile
Molecular FormulaC9H5NO
Molecular Weight143.14
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point260.8±13.0 °C at 760 mmHg
Melting Point84ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79002-39-4 |
| Catalog No. | 2A-9048293 |
| Chinese Name | 苯并呋喃-5-甲腈 |
| Synonyms | 5-cyanobenzo(b)furan; CYANOBENZOFURAN; 5-cyano-1-benzofuran; 5-Benzofurancarbonitrile; Benzofuran-5-carbonitrile; 5-CYANO-BENZOFURAN; 1-Benzofuran-5-carbonitrile |
| Molecular Formula | C9H5NO |
| Molecular Weight | 143.14 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 260.8±13.0 °C at 760 mmHg |
| Melting Point | 84ºC |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2932999099 |
| SMILES | N#Cc1ccc2occc2c1 |
| InChI | InChI=1S/C9H5NO/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5H |
| InChI Key | SXFQAFFSEZRQCJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Methyl 5-bromo-2-chloropyridine-3-carboxylate | 78686-79-0 | 2A-9048265 |
| 3-Amino-4-cyanopyridine | 78790-79-1 | 2A-9048273 |
| 2-Methyl-5-(methyldithio)methylfuran | 78818-78-7 | 2A-9048277 |
| 5-Hydroxy-4-propyl-2(5H)-furanone | 78920-10-2 | 2A-9048287 |
| 7-Chloro-8-methylquinoline | 78941-93-2 | 2A-9048288 |
| 2-Chloro-6-ethoxybenzothiazole | 79071-17-3 | 2A-9048303 |
| 4-Trifluoromethylthiazole-2-carboxylic acid ethyl ester | 79247-86-2 | 2A-9048316 |
| 3-Aminopyrrolidine | 79286-79-6 | 2A-9048324 |
| 2-(4-Chloromethylphenyl)-5-methyl-1,3,4-oxadiazole | 79383-00-9 | 2A-9048332 |
| 2-Bromo-5,6-dimethoxy-3-nitropyridine | 79491-48-8 | 2A-9048345 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA