
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 78950-29-5 |
| Catalog No. | 2A-9048289 |
| Chinese Name | 4-(三氟甲基)苯基乙酸酯 |
| Synonyms | 4-Acetoxy-1-trifluormethyl-benzol |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.15 |
| Purity | 98.00 |
| Density | 1.271g/cm3 |
| Boiling Point | 207.2ºC at 760 mmHg |
| HTC | 2915390090 |
| PubChem ID | 3216940 |
| MDL Number | C9H7F3O2 |
| SMILES | CC(=O)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F3O2/c1-6(13)14-8-4-2-7(3-5-8)9(10,11)12/h2-5H,1H3 |
| InChI Key | DPPGVFHHZGVZED-UHFFFAOYSA-N |
| MSDS | msds/48289_1_78950_29_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Methyl 1-amino-1-cyclopentanecarboxylate | 78388-61-1 | 2A-9048218 |
| Methyl 4-bromo-2-bromomethylbenzoate | 78471-43-9 | 2A-9048225 |
| 2-Fluoro-6-methoxyphenylboronic acid | 78495-63-3 | 2A-9048230 |
| 3-(3'-Trifluoromethylphenyl)propanol | 78573-45-2 | 2A-9048241 |
| 3-Acetamidophenylboronic acid | 78887-39-5 | 2A-9048283 |
| Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate | 79060-88-1 | 2A-9048297 |
| 7-Amino-3-vinyl-3-cephem-4-carboxylic acid diphenylmethyl ester monohydrochloride | 79349-67-0 | 2A-9048328 |
| Dodecylbenzenesulfonyl azide | 79791-38-1 | 2A-9048383 |
| 2-Bromobenzene-1,3-dialdehyde | 79839-49-9 | 2A-9048394 |
| Isopropylboronic acid | 80041-89-0 | 2A-9048426 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA