
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16309-45-8 |
| Catalog No. | 2A-9004820 |
| Chinese Name | 4-(4-硝基苯氧基)苯甲酸 |
| Synonyms | 4-(4-nitrophenoxy)benzoic acid |
| Molecular Formula | C13H9NO5 |
| Molecular Weight | 242.23 |
| Purity | 97 |
| Density | 1.405g/cm3 |
| Boiling Point | 429.3ºC at 760mmHg |
| Melting Point | 270-280 °C |
| Appearance | solid |
| Storage Condition | Room Temperature |
| HTC | 2918990090 |
| PubChem ID | 329767468 |
| MDL Number | MFCD00225268 |
| SMILES | OC(C1=CC=C(/N=N/C2=CC=C(O)C=C2)C=C1)=O |
| InChI | 1S/C13H10N2O3/c16-12-7-5-11(6-8-12)15-14-10-3-1-9(2-4-10)13(17)18/h1-8,16H,(H,17,18)/b15-14+ |
| InChI Key | HLVCZTOFOWHIJZ-CCEZHUSRSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352106 |
| MSDS | msds/4820_1_16309_45_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4-Methoxyphenyl)-2-butanone | 104-20-1 | 2A-9004813 |
| 4-(4-Methoxyphenyl)butyric acid | 4521-28-2 | 2A-9004814 |
| 4-(4-Methylpiperazinomethyl)benzoic acid | 2A-104816 | 2A-9004816 |
| 4-(4-n-Butylphenyl)phenol | 84016-40-0 | 2A-9004817 |
| 4-(4-Nitrophenoxy)aniline | 6149-33-3 | 2A-9004819 |
| 4-(4-Nitrophenyl)thiazol-2-ylamine | 2104-09-8 | 2A-9004823 |
| 4-(4-n-Pentylphenyl)benzoic acid | 59662-47-4 | 2A-9004824 |
| 4-(4-n-Pentylphenyl)phenol | 61760-85-8 | 2A-9004825 |
| 4-(4-n-Propylphenyl)benzoic acid | 88038-94-2 | 2A-9004826 |
| 4-(4-n-Propylphenyl)phenol | 59748-39-9 | 2A-9004827 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA