
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 67565-48-4 |
| Catalog No. | 2A-9004818 |
| Chinese Name | 4-(4-硝基苄氧基)苯甲醛 |
| Synonyms | MFCD00017041; p-Nitrobenzyl-p-formylphenylether |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.248 |
| Purity | 98 |
| Density | 1.301g/cm3 |
| Boiling Point | 456.6ºC at 760mmHg |
| Melting Point | 133-134°C |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2913000090 |
| MDL Number | MFCD00017041 |
| SMILES | O=Cc1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C14H11NO4/c16-9-11-3-7-14(8-4-11)19-10-12-1-5-13(6-2-12)15(17)18/h1-9H,10H2 |
| InChI Key | RIYUFYPNHRLRON-UHFFFAOYSA-N |
| MSDS | msds/4818_1_67565_48_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(3,4-Dichlorobenzyloxy)benzaldehyde | 66742-56-1 | 2A-9004784 |
| 4-(3-Nitrophenyl)-3-thiosemicarbazide | 79925-03-4 | 2A-9004791 |
| 4-(4-Bromo-2,6-dimethylphenyl)-3-thiosemicarbazide | 122813-72-3 | 2A-9004796 |
| 4-(4'-Chlorophenyl)cyclohexancarboxylic acid | 95233-37-7 | 2A-9004802 |
| 4-(4-Chlorophenylthio)-3-nitrobenzaldehyde | 270262-96-9 | 2A-9004803 |
| 4-(4-Nitrophenyl)-3-thiosemicarbazide | 38985-70-5 | 2A-9004822 |
| 4-(Benzyloxycarbonyl)benzeneboronic acid | 184000-11-1 | 2A-9004842 |
| 4-(Bromomethyl)benzil | 18189-19-0 | 2A-9004847 |
| 4-(Cyanomethyl)benzeneboronic acid | 91983-26-5 | 2A-9004849 |
| 4-(Difluoromethoxy)benzaldehyde | 73960-07-3 | 2A-9004851 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA