
CAS Number77775-71-4
SynonymsN-methyl-3,5-dimethoxybenzylamine; 3,5-Dimethoxy-4-methylbenzylalkohol; (3,5-dimethoxy-benzyl)-methyl-amine; (3,5-diMePh)3PO; (3,5-dimethoxy-4-methyl-phenyl)-methanol; 4-hydroxy-3,5-dimethoxyphenylethene; Phosphine oxide,tris(3,5-dimethylphenyl); tris(3,5-dimethylphenyl)phosphine oxide; 3,5-dimethoxy-4-hydroxystyrene; 2,6-dimethoxy-4-ethenylphenol; 4-vinylsyringol; (3',5'-dimethoxy-4'-hydroxyphenyl)-1-ethene; 3,5-dimethoxy-4-methylphenylmethyl alcohol; 3,5-dimethoxy-4-methylbenzyl alcohol
Molecular FormulaC10H15NO2
Molecular Weight181.23200
Purity98.00%
Boiling Point272.7°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 77775-71-4 |
| Catalog No. | 2A-9048154 |
| Chinese Name | (3,5-二甲氧基苯基)-N-甲基甲胺 |
| Synonyms | N-methyl-3,5-dimethoxybenzylamine; 3,5-Dimethoxy-4-methylbenzylalkohol; (3,5-dimethoxy-benzyl)-methyl-amine; (3,5-diMePh)3PO; (3,5-dimethoxy-4-methyl-phenyl)-methanol; 4-hydroxy-3,5-dimethoxyphenylethene; Phosphine oxide,tris(3,5-dimethylphenyl); tris(3,5-dimethylphenyl)phosphine oxide; 3,5-dimethoxy-4-hydroxystyrene; 2,6-dimethoxy-4-ethenylphenol; 4-vinylsyringol; (3',5'-dimethoxy-4'-hydroxyphenyl)-1-ethene; 3,5-dimethoxy-4-methylphenylmethyl alcohol; 3,5-dimethoxy-4-methylbenzyl alcohol |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23200 |
| Purity | 98.00 |
| Boiling Point | 272.7°C |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| PubChem ID | 37497463 |
| SMILES | CNCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C10H15NO2/c1-11-7-8-4-9(12-2)6-10(5-8)13-3/h4-6,11H,7H2,1-3H3 |
| InChI Key | AZLYFFWKOFXIRJ-UHFFFAOYSA-N |
| MSDS | msds/48154_1_77775_71_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (5beta,7alpha,12alpha)-7,12-Dihydroxychol-2-en-24-oic acid methyl ester | 77731-10-3 | 2A-9048145 |
| (5beta,7alpha,12alpha)-7,12-Dihydroxychol-3-en-24-oic acid methyl ester | 77731-11-4 | 2A-9048146 |
| [2-(3-Cyclohexenyl)ethyl]triethoxysilane | 77756-79-7 | 2A-9048149 |
| (Perfluoro-n-hexyl)phenyliodonium trifluoromethanesulfonate | 77758-84-0 | 2A-9048150 |
| 2-Fluoro-3-methylphenol | 77772-72-6 | 2A-9048153 |
| 4-Bromo-2-methyl-6-nitroaniline | 77811-44-0 | 2A-9048156 |
| Manganese fluoride | 77822-64-1 | 2A-9048158 |
| Anilino-methyl-trimethoxysilane | 77855-73-3 | 2A-9048159 |
| N,N-Diisopropylnicotinamide | 77924-01-7 | 2A-9048166 |
| N,N-Diisopropylisonicotinamide | 77924-05-1 | 2A-9048167 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA