
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 76619-89-1 |
| Catalog No. | 2A-9048015 |
| Chinese Name | 3-氨基-5-甲基苯酚 |
| Synonyms | 3-Amino-5-methylphenol |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 281.1±20.0 °C at 760 mmHg |
| Melting Point | 139-140°C |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| PubChem ID | 10041947 |
| SMILES | Cc1cc(N)cc(O)c1 |
| InChI | InChI=1S/C7H9NO/c1-5-2-6(8)4-7(9)3-5/h2-4,9H,8H2,1H3 |
| InChI Key | NCUABBHFJSFKOJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sultamicillin | 76497-13-7 | 2A-9048002 |
| (aR,bS)-rel-alpha-Hydroxy-beta-[[(phenylmethoxy)carbonyl]amino]benzenebutanoic acid | 76498-22-1 | 2A-9048004 |
| 4-Bromoisatoic anhydride | 76561-16-5 | 2A-9048008 |
| 2-(2,3-Dimethylphenyl)acetonitrile | 76574-43-1 | 2A-9048009 |
| 4-(6-Chloroquinoxalin-2-yloxy)phenol | 76578-79-5 | 2A-9048011 |
| 4-(3-Methyl-1,2,4-oxadiazol-5-yl)aniline | 76635-31-9 | 2A-9048016 |
| Cefbuperazone sodium | 76648-01-6 | 2A-9048017 |
| Disodium 2,2'-dihydroxy-4,4'-dimethoxy-5,5'-disulfobenzophenone | 76656-36-5 | 2A-9048019 |
| 4-[(5-Bromo-2-pyrimidinyl)oxy]aniline | 76660-37-2 | 2A-9048020 |
| Flutriafol | 76674-21-0 | 2A-9048021 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA