
CAS Number75887-54-6
SynonymsSM-227; β-arteether; Areether; Artemotil; SM-22; ARPRINOCID; dihydroartemisinin ethyl ether; dihydroqinghaosu ethyl ether
Molecular FormulaC17H28O5
Molecular Weight312.40
Purity≥95 (HPLC)%
Density1.2±0.1 g/cm3
Boiling Point372.4±42.0 °C at 760 mmHg
Melting Point80-820ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 75887-54-6 |
| Catalog No. | 2A-9047930 |
| Chinese Name | 蒿乙醚 |
| Synonyms | SM-227; β-arteether; Areether; Artemotil; SM-22; ARPRINOCID; dihydroartemisinin ethyl ether; dihydroqinghaosu ethyl ether |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.40 |
| Purity | ≥95 (HPLC) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 372.4±42.0 °C at 760 mmHg |
| Melting Point | 80-820ºC |
| Appearance | powder |
| Storage Condition | 2-8°C |
| Application | Artemotil (β-Arteether) is specifically designed to treat Chloroquine-resistant falciparum malaria and cerebral malaria and is a rapid schizonticide in the blood. |
| PubChem ID | 10036204 |
| MDL Number | MFCD00869355 |
| SMILES | O1OC2(O[C@H]3O[C@@H]([C@@H]([C@H]4[C@]31[C@H]([C@@H](CC4)C)CC2)C)OCC)C |
| InChI | 1S/C17H28O5/c1-5-18-14-11(3)13-7-6-10(2)12-8-9-16(4)20-15(19-14)17(12,13)22-21-16/h10-15H,5-9H2,1-4H3/t10-,11-,12+,13+,14+,15-,16?,17-/m1/s1 |
| InChI Key | NLYNIRQVMRLPIQ-BVCZABNKSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 51111800 |
| MSDS | msds/47930_1_75887_54_6.pdf |
| Transport Info | Product name: Artemether |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(1,1,2,2-Tetrafluoroethoxy)chlorobenzene | 75820-58-5 | 2A-9047919 |
| 2,5-Difluorobenzyl alcohol | 75853-20-2 | 2A-9047924 |
| 12-Methyltridecanal | 75853-49-5 | 2A-9047925 |
| Alcian Blue 8GX | 75881-23-1 | 2A-9047926 |
| 6-Bromophthalazin-1(2H)-one | 75884-70-7 | 2A-9047927 |
| 2-Fluorothiobenzamide | 75907-82-3 | 2A-9047933 |
| Melanotan-1 | 75921-69-6 | 2A-9047934 |
| 3-Bromo-2-methylbenzoic acid | 76006-33-2 | 2A-9047945 |
| 3-Methoxy-2-methyl-1H-pyridin-4-one | 76015-11-7 | 2A-9047946 |
| Cerium(III) trifluoromethanesulfonate | 76089-77-5 | 2A-9047952 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA