
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 75763-51-8 |
| Catalog No. | 2A-9047911 |
| Chinese Name | 2'-氨基脱氧肌苷 |
| Synonyms | 2'-Amino-2'-deoxyinosine; Inosine,2'-amino-2'-deoxy |
| Molecular Formula | C10H13O4N5 |
| Molecular Weight | 267.24 |
| Purity | 98.00 |
| Density | 2.08g/cm3 |
| Boiling Point | 710.5ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2922199090 |
| PubChem ID | 33516136 |
| MDL Number | MFCD09750831 |
| SMILES | NC1C(O)C(CO)OC1n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C10H13N5O4/c11-5-7(17)4(1-16)19-10(5)15-3-14-6-8(15)12-2-13-9(6)18/h2-5,7,10,16-17H,1,11H2,(H,12,13,18)/t4-,5-,7-,10-/m1/s1 |
| InChI Key | PPLSURAOXNSSRH-QYYRPYCUSA-N |
| MSDS | msds/47911_1_75763_51_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Biotechnology & Diagnostics | ||
|---|---|---|
| 3-Amino-Boc-L-alanine | 73259-81-1 | 2A-9047568 |
| Boc-D-Proline methyl ester | 73323-65-6 | 2A-9047578 |
| Fmoc-L-Serine | 73724-45-5 | 2A-9047645 |
| 5'-O-(4,4'-Dimethoxytrityl)-thymidine-3'-O-succinic acid | 74405-40-6 | 2A-9047745 |
| Boc-D-Asparagine | 75647-01-7 | 2A-9047897 |
| 1-Boc-3-oxopiperazine | 76003-29-7 | 2A-9047941 |
| Fmoc-N-epsilon-trifluoroacetyl-L-lysine | 76265-69-5 | 2A-9047971 |
| N-alpha-Boc-D-2,3-diaminopropionic acid | 76387-70-7 | 2A-9047989 |
| N-Boc-N'-Cbz-D-lysine | 76477-42-4 | 2A-9047998 |
| Boc-O-ethyl-D-tyrosine | 76757-92-1 | 2A-9048031 |
| Browse all Biotechnology & Diagnostics products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA