
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 74230-08-3 |
| Catalog No. | 2A-9047720 |
| Chinese Name | 4-羟基-2-硝基苯甲酸 |
| Synonyms | 4-Hydroxy-2-nitrobenzoic acid |
| Molecular Formula | HOC6H3(NO2)CO2H |
| Molecular Weight | 183.12 |
| Purity | 97 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 414.0±40.0 °C at 760 mmHg |
| Melting Point | 235-239 °C (lit.) |
| Storage Condition | Room temperature, dry and sealed |
| EINECS | 210-584-0 |
| HTC | 2918290000 |
| PubChem ID | 24847317 |
| MDL Number | MFCD00071505 |
| SMILES | OC(=O)c1ccc(cc1O)[N+]([O-])=O |
| InChI | 1S/C7H5NO5/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,9H,(H,10,11) |
| InChI Key | UKWUOTZGXIZAJC-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/47720_1_74230_08_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-(3,4-Diaminophenyl)-4,5-dihydro-5-methyl-3(2H)-pyridazinone | 74150-02-0 | 2A-9047707 |
| 1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene | 74159-80-1 | 2A-9047709 |
| 2,2-Dimethyl-1,3-dioxan-5-one | 74181-34-3 | 2A-9047712 |
| Sulfometuron | 74223-56-6 | 2A-9047717 |
| Bis(4-(diphenylsulfonio)phenyl)sulfide bis(hexafluorophosphate) | 74227-35-3 | 2A-9047719 |
| 2-[3-(1,3-Dihydro-1,1,3-trimethyl-2H-benz[e]indol-2-ylidene)-1-propen-1-yl]-1,1,3-trimethyl-1H-benz[e]indolium perchlorate | 74276-27-0 | 2A-9047724 |
| L-Alanine-D7 | 74280-71-0 | 2A-9047725 |
| 3-Bromo-5-methylpyrazin-2-amine | 74290-65-6 | 2A-9047728 |
| Dehydrocostuslactone | 74299-48-2 | 2A-9047730 |
| 4-Pentylphenyl 4-pentylbenzoate | 74305-48-9 | 2A-9047731 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA