
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 74190-66-2 |
| Catalog No. | 2A-9047713 |
| Chinese Name | 2-(4-甲氧苯基)吡咯烷 |
| Synonyms | MFCD01631836; 2-(4-methoxyphenyl)pyrrolidine |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.243 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 282.8±33.0 °C at 760 mmHg |
| Appearance | Liquid;Colorless to Light yellow to Light orange clear liquid |
| Storage Condition | Store under inert gas; avoid air |
| HTC | 2933990090 |
| PubChem ID | 5277257 |
| SMILES | COc1ccc(C2CCCN2)cc1 |
| InChI | InChI=1S/C11H15NO/c1-13-10-6-4-9(5-7-10)11-3-2-8-12-11/h4-7,11-12H,2-3,8H2,1H3/p+1/t11-/m0/s1 |
| InChI Key | HCBLZPKEGFYHDN-UHFFFAOYSA-N |
| MSDS | msds/47713_1_74190_66_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Ethyl 6-quinolinecarboxylate | 73987-38-9 | 2A-9047686 |
| 3-Bromo-5-hydroxypyridine | 74115-13-2 | 2A-9047700 |
| 4-(4-Bromophenoxy)piperidine | 74130-05-5 | 2A-9047703 |
| 4-Methoxypyridine-3-carbonitrile | 74133-20-3 | 2A-9047704 |
| 5-Chloro-2-thiophenemethanol | 74168-69-7 | 2A-9047711 |
| 3-(Bromomethyl)-2,6,7-trimethyl-1H,5H-pyrazolo[1,2-a]pyrazole-1,5-dione | 74235-78-2 | 2A-9047721 |
| 1-(Mesitylene-2-sulfonyl)-3-nitro-1,2,4-triazole | 74257-00-4 | 2A-9047722 |
| 2-Amino-3,5-dibromo-6-methylpyrazine | 74290-66-7 | 2A-9047729 |
| 3,5-Dimethyl-4-isoxazolecarboxamide | 74356-30-2 | 2A-9047738 |
| 5-Chloro-3-chloromethyl-[1,2,4]thiadiazole | 74461-64-6 | 2A-9047755 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA