
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 172932-10-4 |
| Catalog No. | 2A-9004767 |
| Chinese Name | 4-(2-氯-6-氟-苄基)氧基苯甲醛 |
| Synonyms | MFCD00052227; 4-[(2-chloro-6-fluorophenyl)methoxy]benzaldehyde |
| Molecular Formula | C14H10ClFO2 |
| Molecular Weight | 264.67900 |
| Purity | 96 |
| Density | 1.31g/cm3 |
| Boiling Point | 388.8ºC at 760 mmHg |
| Melting Point | 80-82ºC |
| HTC | 2913000090 |
| SMILES | O=Cc1ccc(OCc2c(F)cccc2Cl)cc1 |
| InChI Key | WOUZCDNRKXWPDY-UHFFFAOYSA-N |
| MSDS | msds/4767_2_172932_10_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Trifluoromethyl-4-bromoanisole | 400-72-6 | 2A-9004739 |
| 3-Trifluoromethylbenzyl alcohol | 349-75-7 | 2A-9004740 |
| 3-Trifluoromethylbenzyl bromide | 402-23-3 | 2A-9004741 |
| 3-Trifluoromethylphenyl acetonitrile | 2338-76-3 | 2A-9004742 |
| 4-(1-Naphthyl)-3-thiosemicarbazide | 42135-78-4 | 2A-9004750 |
| 4-(2-Hydroxyethyl)piperazin-1-carboxylic acidethyl ester | 14000-66-9 | 2A-9004771 |
| 4-(2-Nitrophenyl)-3-thiosemicarbazide | 73305-12-1 | 2A-9004779 |
| 4-(3,4-Dichlorobenzyloxy)-3-nitrobenzaldehyde | 175136-20-6 | 2A-9004783 |
| 4-(3,4-Dichlorobenzyloxy)benzaldehyde | 66742-56-1 | 2A-9004784 |
| 4-(3-Nitrophenyl)-3-thiosemicarbazide | 79925-03-4 | 2A-9004791 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA