CAS Number106266-04-0
Synonyms(2,4-Difluorophenyl)(4-piperidinyl)methanone hydrochloride; (2,4-Difluorphenyl)(piperidin-4-yl)methanonhydrochlorid; (2,4-Difluorophenyl)(piperidin-4-yl)methanone hydrochloride (1:1); (2,4-difluorophenyl)-piperidin-4-ylmethanone,hydrochloride; 4-(2,4-Difluorobenzoyl)piperidine hydrochloride; Methanone, (2,4-difluorophenyl)-4-piperidinyl-, hydrochloride (1:1); MFCD08282775; (2,4-Difluorophenyl)(4-piperidinyl)methanone hydrochloride (1:1); (2,4-Difluorophenyl)(piperidin-4-yl)methanone hydrochloride
Molecular FormulaC12H14ClF2NO
Molecular Weight261.695
Purity99%
Density1,02 g/cm3
Boiling Point122°C 9mm
Melting Point203-206°C (dec.)
AppearanceWhite or light brown powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 106266-04-0 |
| Catalog No. | 2A-9004753 |
| Chinese Name | 4-(2,4-二氟苯甲酰基)-哌啶盐酸盐 |
| Synonyms | (2,4-Difluorophenyl)(4-piperidinyl)methanone hydrochloride; (2,4-Difluorphenyl)(piperidin-4-yl)methanonhydrochlorid; (2,4-Difluorophenyl)(piperidin-4-yl)methanone hydrochloride (1:1); (2,4-difluorophenyl)-piperidin-4-ylmethanone,hydrochloride; 4-(2,4-Difluorobenzoyl)piperidine hydrochloride; Methanone, (2,4-difluorophenyl)-4-piperidinyl-, hydrochloride (1:1); MFCD08282775; (2,4-Difluorophenyl)(4-piperidinyl)methanone hydrochloride (1:1); (2,4-Difluorophenyl)(piperidin-4-yl)methanone hydrochloride |
| Molecular Formula | C12H14ClF2NO |
| Molecular Weight | 261.695 |
| Purity | 99 |
| Density | 1,02 g/cm3 |
| Boiling Point | 122°C 9mm |
| Melting Point | 203-206°C (dec.) |
| Appearance | White or light brown powder |
| Water Solubility | Water solubility: soluble |
| Storage Condition | Sealed and stored in a cool, dry warehouse. Keep a |
| HTC | 2933399090 |
| SMILES | Cl.O=C(c1ccc(F)cc1F)C1CCNCC1 |
| InChI Key | QPJONRGTWKXJLG-UHFFFAOYSA-N |
| MSDS | msds/4753_1_106266_04_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 3-Hydroxy-2,4,5-trifluorobenzoic acid | 116751-24-7 | 2A-9004528 |
| 3-Methoxy-2,4,5-trifluorobenzoic acid | 112811-65-1 | 2A-9004589 |
| 3-Methoxy-2,4,5-trifluorobenzonitrile | 2A-104590 | 2A-9004590 |
| 3-Methoxy-2,4-difluorobenzonitrile | 220353-20-8 | 2A-9004591 |
| 3-Methyl-2,4,5-trifluorobenzoic acid | 112822-85-2 | 2A-9004612 |
| 4-(2,4-Dinitrophenyl)butanoic acid | 52120-49-7 | 2A-9004754 |
| 4-Bromo-2-fluorobenzyl mercaptan | 2A-105350 | 2A-9005350 |
| 4-Bromobenzyl mercaptan | 19552-10-4 | 2A-9005492 |
| 4-Toluenesulfonylurea | 1694-06-0 | 2A-9006133 |
| 5-(2,4-Dichlorophenyl)-4-methyl-1,2,4-triazole-3-thiol | 162693-41-6 | 2A-9006143 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS