
CAS Number71887-28-0
Synonymsmethyl 2-(bromomethyl)-3-methoxy-benzoate; 2-bromomethyl-3-methoxy benzoic acid methyl ester; methyl-3-methoxy-2-bromomethylbenzoate; Methyl 2-bromomethyl-3-methoxybenzoate
Molecular FormulaC10H11BrO3
Molecular Weight259.09700
Purity98.00%
Density1.432
Boiling Point330ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 71887-28-0 |
| Catalog No. | 2A-9047370 |
| Chinese Name | 2-溴甲基-3-甲氧基苯甲酸甲酯 |
| Synonyms | methyl 2-(bromomethyl)-3-methoxy-benzoate; 2-bromomethyl-3-methoxy benzoic acid methyl ester; methyl-3-methoxy-2-bromomethylbenzoate; Methyl 2-bromomethyl-3-methoxybenzoate |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.09700 |
| Purity | 98.00 |
| Density | 1.432 |
| Boiling Point | 330ºC at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2918990090 |
| PubChem ID | 38615630 |
| SMILES | COC(=O)c1cccc(OC)c1CBr |
| InChI | InChI=1S/C10H11BrO3/c1-13-9-5-3-4-7(8(9)6-11)10(12)14-2/h3-5H,6H2,1-2H3 |
| InChI Key | HYLGKOGJOVGRNN-UHFFFAOYSA-N |
| MSDS | msds/47370_1_71887_28_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,4-Dioxo-1,2,3,4-tetrahydro-5-pyrimidinylboronic acid | 70523-22-7 | 2A-9047179 |
| 2-Cyano-3-thioenylcarboxylic acid | 71154-34-2 | 2A-9047264 |
| Triethyl 3-bromopropane-1,1,1-tricarboxylate | 71170-82-6 | 2A-9047266 |
| trans-1-(Bromomethyl)-4-propylcyclohexane | 71458-12-3 | 2A-9047305 |
| 4-Hydroxyphenylboronic acid | 71597-85-8 | 2A-9047323 |
| D-1,2,3,4-Tetrahydronorharman-3-carboxylic acid | 72002-54-1 | 2A-9047399 |
| Ethyl 7-hydroxy-5-oxo-1,2,3,5-tetrahydroindolizine-8-carboxylate | 72130-68-8 | 2A-9047419 |
| 2-Hexylcyclopropanecarboxylic acid methyl ester | 72229-09-5 | 2A-9047431 |
| 4-(Trifluoromethyl)thiobenzamide | 72505-21-6 | 2A-9047458 |
| Vinylmethylbis(methylethylketoxime)silane | 72721-10-9 | 2A-9047488 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA