
CAS Number71620-89-8
Synonyms(±)-(2S,3S)-iodoreboxetine; Oxirane,2-(bromomethyl)-3-phenyl; Esreboxetine; (2S)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine; (S)-2-[(S)-(2-Ethoxy-phenoxy)-phenyl-methyl]-morpholine; 3-Bromomethyl-2-phenyloxirane; (S)-2-((S)-(2-ethoxyphenoxy)(phenyl)methyl)morpholine; (±)-(2S,3R)-2-(bromomethyl)-3-phenyloxirane; 1-bromo-2,3-epoxy-3-phenylpropane; 2-bromomethyl-3-phenyloxirane; trans-3-bromo-1-phenyl-1,2-epoxypropane; MFCD00869653; trans-Cinnamyl bromide epoxide; (2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine
Molecular FormulaC19H23NO3
Molecular Weight409.50 (anhydrous basis)
Purity>96 (HPLC)%
Density1.1±0.1 g/cm3
Boiling Point443.7±30.0 °C at 760 mmHg
Melting Point141-143ºC
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 71620-89-8 |
| Catalog No. | 2A-9047328 |
| Chinese Name | 瑞波西汀 |
| Synonyms | (±)-(2S,3S)-iodoreboxetine; Oxirane,2-(bromomethyl)-3-phenyl; Esreboxetine; (2S)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine; (S)-2-[(S)-(2-Ethoxy-phenoxy)-phenyl-methyl]-morpholine; 3-Bromomethyl-2-phenyloxirane; (S)-2-((S)-(2-ethoxyphenoxy)(phenyl)methyl)morpholine; (±)-(2S,3R)-2-(bromomethyl)-3-phenyloxirane; 1-bromo-2,3-epoxy-3-phenylpropane; 2-bromomethyl-3-phenyloxirane; trans-3-bromo-1-phenyl-1,2-epoxypropane; MFCD00869653; trans-Cinnamyl bromide epoxide; (2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 409.50 (anhydrous basis) |
| Purity | >96 (HPLC) |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 443.7±30.0 °C at 760 mmHg |
| Melting Point | 141-143ºC |
| Appearance | solid |
| Storage Condition | Desiccate at +4°C |
| Application | Repotin is an orally active, potent, and selective norepinephrine uptake blocker. Repotin can be used in antidepressant research [1]. |
| PubChem ID | 24724592 |
| MDL Number | MFCD11046031 |
| SMILES | O.CS(O)(=O)=O.CCOc1ccccc1O[C@@H]([C@H]2CNCCO2)c3ccccc3 |
| InChI | 1S/C19H23NO3.CH4O3S.H2O/c1-2-21-16-10-6-7-11-17(16)23-19(15-8-4-3-5-9-15)18-14-20-12-13-22-18;1-5(2,3)4;/h3-11,18-20H,2,12-14H2,1H3;1H3,(H,2,3,4);1H2/t18-,19-;;/m1../s1 |
| InChI Key | SZPHEVAYLIVGRC-BAMQSBMESA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/47328_1_71620_89_8.pdf |
| Transport Info | Product Name: Reboxetine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Dimethoxy-4-ethylphenethylamine | 71539-34-9 | 2A-9047317 |
| Poly(allylamine hydrochloride) | 71550-12-4 | 2A-9047318 |
| Methyl 5-methoxyisophthalate | 71590-08-4 | 2A-9047322 |
| Di-p-toluoyl-D-tartaric acid monohydrate | 71607-31-3 | 2A-9047325 |
| Isopentyl 4-methoxycinnamate | 71617-10-2 | 2A-9047327 |
| N-[2-Hydroxy-2-(4-methoxyphenyl)ethyl]-2-(2-chloro-3,4-dimethoxyphenyl)ethylamine | 71636-38-9 | 2A-9047330 |
| 2-Methoxy-4-amino-5-ethylthiobenzoic acid | 71675-86-0 | 2A-9047336 |
| 1-(4-Acetylphenyl)-2-thiourea | 71680-92-7 | 2A-9047338 |
| Calcium 2-oxoglutarate | 71686-01-6 | 2A-9047339 |
| Allyl 2,3-O-isopropylidene-alpha-L-rhamnopyranoside | 71695-57-3 | 2A-9047341 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA