
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70958-20-2 |
| Catalog No. | 2A-9047243 |
| Chinese Name | 2-(5-氯-2-苯氧基苯基)乙酸 |
| Synonyms | 2-(5-chloro-2-phenoxyphenyl)acetic acid; (5-Chloro-2-phenoxyphenyl)acetic acid |
| Molecular Formula | C14H11ClO3 |
| Molecular Weight | 262.69 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 395.1±32.0 °C at 760 mmHg |
| Melting Point | 123-125ºC |
| Appearance | solid |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| PubChem ID | 329816475 |
| MDL Number | MFCD07368830 |
| SMILES | O=C(O)CC1=CC(Cl)=CC=C1OC2=CC=CC=C2 |
| InChI | 1S/C14H11ClO3/c15-11-6-7-13(10(8-11)9-14(16)17)18-12-4-2-1-3-5-12/h1-8H,9H2,(H,16,17) |
| InChI Key | PKMKNEIUKHPJAX-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/47243_1_70958_20_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dimethoxymethyloctadecylsilane | 70851-50-2 | 2A-9047228 |
| Poly(dimethylsiloxane) hydride terminated | 70900-21-9 | 2A-9047232 |
| Angiotensin I human acetate salt hydrate | 70937-97-2 | 2A-9047240 |
| 3-(Trihydroxysilyl)propanesulfonic acid | 70942-24-4 | 2A-9047241 |
| alpha-(4-Methoxybenzoyl)-alpha-(1-benzyl-5-ethoxyhydantion)-2-chloro-5-dodecyloxycarbonyl acetanilide | 70950-45-7 | 2A-9047242 |
| 3-Amino-2-hydroxyacetophenone | 70977-72-9 | 2A-9047244 |
| tert-Butyl (4-aminophenyl)carbamate | 71026-66-9 | 2A-9047246 |
| 4,4,4-Trifluorocrotonic acid | 71027-02-6 | 2A-9047247 |
| Poly (acrylic acid-co-hypophosphite) sodium salt | 71050-62-9 | 2A-9047250 |
| 4-Hydroxybenzoic acid hexadecyl ester | 71067-09-9 | 2A-9047251 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA