![1-[2-(4-Fluorophenyl)ethyl]piperazine structure, CAS 70931-33-8](/structures/60000/47239_1_70931_33_8.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70931-33-8 |
| Catalog No. | 2A-9047239 |
| Chinese Name | 1-[2-(4-氟苯基)乙基]哌嗪 |
| Molecular Formula | C12H17N2F1 |
| Molecular Weight | 208.28 |
| Purity | 98.00 |
| Density | 1.062 |
| Boiling Point | 302ºC |
| Storage Condition | 2-8°C, avoid light and dry |
| HTC | 2933599090 |
| PubChem ID | 16399154 |
| MDL Number | MFCD09839701 |
| SMILES | Fc1ccc(CCN2CCNCC2)cc1 |
| InChI | InChI=1S/C12H17FN2/c13-12-3-1-11(2-4-12)5-8-15-9-6-14-7-10-15/h1-4,14H,5-10H2 |
| InChI Key | LODHVDKKTUZVDK-UHFFFAOYSA-N |
| MSDS | msds/47239_1_70931_33_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Methyl-1H-imidazole-2-carboxylic acid | 70631-93-5 | 2A-9047199 |
| Adenine phosphate | 70700-30-0 | 2A-9047209 |
| 4-Amino-2-dimethylamino-6-hydroxy-5-nitrosopyrimidine | 70700-44-6 | 2A-9047210 |
| alpha-D-Ribofuranose 1-acetate 2,3,5-tribenzoate | 70832-64-3 | 2A-9047225 |
| N-(2-Methylphenyl)piperazine hydrochloride | 70849-60-4 | 2A-9047226 |
| 4,4'-Bis(methoxycarbonly)-2,2'-bipyridine | 71071-46-0 | 2A-9047252 |
| 7-(Trifluoromethyl)quinoline-3-carboxylic acid | 71082-51-4 | 2A-9047255 |
| Thiophene-2,3-dicarboxylic acid | 71189-23-6 | 2A-9047269 |
| 2-Methyl-5-phenylbenzothiazole | 71215-89-9 | 2A-9047272 |
| 2-Aminobenzothiazole-7-carboxylic acid | 71224-95-8 | 2A-9047274 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA