CAS Number70643-19-5
Synonyms2-(2,4-diaminophenoxy)ethanol; 2,3-DIPHENYL-5-CYANOTETRAZOLIUM CHLORIDE; 1-(2-hydroxyethyloxy)-2,4-diaminobenzene; 2,4-diamino phenoxyethanol; 2,4-diamino-1-(-hydroxyethyloxy)benzene; 2,4-DIAMINOPHENOXYETHANOL HYDROCHLORIDE; Ethanol,2-(2,4-diaminophenoxy); MFCD07787508; 2,4-diamino-1-(2-hydroxyethoxy)-benzene
Molecular FormulaC8H12O2N2
Molecular Weight168.2
Purity98.00%
Density1.274 g/cm3
Boiling Point400.2ºC at 760 mmHg
Melting Point≥222ºC
Appearancegray white powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70643-19-5 |
| Catalog No. | 2A-9047201 |
| Chinese Name | 2,4-二氨基苯氧基乙醇 |
| Synonyms | 2-(2,4-diaminophenoxy)ethanol; 2,3-DIPHENYL-5-CYANOTETRAZOLIUM CHLORIDE; 1-(2-hydroxyethyloxy)-2,4-diaminobenzene; 2,4-diamino phenoxyethanol; 2,4-diamino-1-(-hydroxyethyloxy)benzene; 2,4-DIAMINOPHENOXYETHANOL HYDROCHLORIDE; Ethanol,2-(2,4-diaminophenoxy); MFCD07787508; 2,4-diamino-1-(2-hydroxyethoxy)-benzene |
| Molecular Formula | C8H12O2N2 |
| Molecular Weight | 168.2 |
| Purity | 98.00 |
| Density | 1.274 g/cm3 |
| Boiling Point | 400.2ºC at 760 mmHg |
| Melting Point | ≥222ºC |
| Appearance | gray white powder |
| HTC | 2922299090 |
| PubChem ID | 6842315 |
| MDL Number | MFCD00190137 |
| SMILES | Nc1ccc(OCCO)c(N)c1 |
| InChI | InChI=1S/C8H12N2O2.2ClH/c9-6-1-2-8(7(10)5-6)12-4-3-11;;/h1-2,5,11H,3-4,9-10H2;2*1H |
| InChI Key | WCPGNFONICRLCL-UHFFFAOYSA-N |
| MSDS | msds/47201_1_70643_19_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Glyphosate-diammonium | 69254-40-6 | 2A-9046989 |
| 5-Bromo-2,4-dimethylnitrobenzene | 69383-59-1 | 2A-9047010 |
| (2E,4E)-5-(4-Methoxy-2,3,6-trimethylphenyl)-3-methylpenta-2,4-dienal | 69877-38-9 | 2A-9047080 |
| Bis(2,4-di-tert-butylphenyl)phenyl phosphonite | 70146-21-3 | 2A-9047122 |
| Methyl 2,4-dibromobutyrate | 70288-65-2 | 2A-9047142 |
| Methyl (2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate | 71283-65-3 | 2A-9047282 |
| Fenoxaprop-p-ethyl | 71283-80-2 | 2A-9047283 |
| 1-Ethylimidazolidine-2,4,5-trione 5-(O-methyloxime) | 71342-67-1 | 2A-9047292 |
| theta-Cypermethrin | 71697-59-1 | 2A-9047342 |
| Fenoxycarb | 72490-01-8 | 2A-9047456 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS