CAS Number59447-12-0
SynonymsEthyl 3-oxo-3-(4-phenoxyphenyl)propanoate; AC-7779; Benzenepropanoic acid, β-oxo-4-phenoxy-, ethyl ester; ethyl 4-phenoxybenzoylacetate; 4-phenoxybenzoyl-acetic acid ethyl ester
Molecular FormulaC17H16O4
Molecular Weight284.31
Purity98%
Density1.2±0.1 g/cm3
Boiling Point399.8±22.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 59447-12-0 |
| Catalog No. | 2A-9004704 |
| Chinese Name | 3-氧-3-(4-苯氧基-苯基)-丙酸乙酯 |
| Synonyms | Ethyl 3-oxo-3-(4-phenoxyphenyl)propanoate; AC-7779; Benzenepropanoic acid, β-oxo-4-phenoxy-, ethyl ester; ethyl 4-phenoxybenzoylacetate; 4-phenoxybenzoyl-acetic acid ethyl ester |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 399.8±22.0 °C at 760 mmHg |
| HTC | 2918990090 |
| MDL Number | MFCD03424833 |
| SMILES | CCOC(=O)CC(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI Key | CAXNCSRMNJVMKD-UHFFFAOYSA-N |
| MSDS | msds/4704_1_59447_12_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Oxo-3-(2-tolyl)propionic acid ethyl ester | 51725-82-7 | 2A-9004697 |
| 3-Oxo-3-(2-tolyl)propionic acid methyl ester | 147501-26-6 | 2A-9004698 |
| 3-Oxo-3-(3,4,5-trimethoxyphenyl)propionic acid methyl ester | 139148-39-3 | 2A-9004700 |
| 3-Oxo-3-(3-tolyl)propionic acid ethyl ester | 33166-79-9 | 2A-9004701 |
| 3-Oxo-3-(3-tolyl)propionic acid methyl ester | 200404-35-9 | 2A-9004702 |
| 3-Oxo-3-(4-phenoxyphenyl)propionic acid methyl ester | 85778-54-7 | 2A-9004705 |
| 3-Oxo-3-(4-tolyl)propionic acid ethyl ester | 27835-00-3 | 2A-9004706 |
| 3-Oxo-3-(4-tolyl)propionic acid methyl ester | 2A-104707 | 2A-9004707 |
| 3-Oxo-3-pentafluorophenylpropionic acid ethyl ester | 3516-87-8 | 2A-9004709 |
| 3-Oxo-3-pentafluorophenylpropionic acid methyl ester | 2A-104710 | 2A-9004710 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS