CAS Number3044-56-2
Synonymsethyl 3-oxo-3-(3,4,5-trimethoxy-phenyl)-propanoate; Benzenepropanoic acid, 3,4,5-trimethoxy-β-oxo-, ethyl ester; Ethyl 3,4,5-trimethoxybenzoylacetate; EINECS 221-251-4; Butyric 3,4,5-trimethoxybenzoic anhydride; ethyl trimethoxybenzoyl acetate; 3.4.5-Trimethoxy-benzoylessigsaeure-aethylester; Trimethylgalloylessigsaeure-aethylester; Ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate; MFCD08063959; 3-Oxo-3-(3,4,5-trimethoxy-phenyl)-propionic acid ethyl ester
Molecular Formula(CH3O)3C6H2COCH2CO2C2H5
Molecular Weight282.29
Purity95%
Density1.1±0.1 g/cm3
Boiling Point374.9±37.0 °C at 760 mmHg
Melting Point88-91 °C (lit.)
AppearanceWhite crystalline powder
EINECS221-251-4
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3044-56-2 |
| Catalog No. | 2A-9004691 |
| Chinese Name | 3,4,5-三甲氧基苯甲酰乙酸乙酯 |
| Synonyms | ethyl 3-oxo-3-(3,4,5-trimethoxy-phenyl)-propanoate; Benzenepropanoic acid, 3,4,5-trimethoxy-β-oxo-, ethyl ester; Ethyl 3,4,5-trimethoxybenzoylacetate; EINECS 221-251-4; Butyric 3,4,5-trimethoxybenzoic anhydride; ethyl trimethoxybenzoyl acetate; 3.4.5-Trimethoxy-benzoylessigsaeure-aethylester; Trimethylgalloylessigsaeure-aethylester; Ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate; MFCD08063959; 3-Oxo-3-(3,4,5-trimethoxy-phenyl)-propionic acid ethyl ester |
| Molecular Formula | (CH3O)3C6H2COCH2CO2C2H5 |
| Molecular Weight | 282.29 |
| Purity | 95 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 374.9±37.0 °C at 760 mmHg |
| Melting Point | 88-91 °C (lit.) |
| Appearance | White crystalline powder |
| Storage Condition | Sealed and stored in a cool, dry warehouse. Keep a |
| EINECS | 221-251-4 |
| HTC | 2918990090 |
| PubChem ID | 24873671 |
| MDL Number | MFCD00026908 |
| SMILES | CCOC(=O)CC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | 1S/C14H18O6/c1-5-20-13(16)8-10(15)9-6-11(17-2)14(19-4)12(7-9)18-3/h6-7H,5,8H2,1-4H3 |
| InChI Key | VEYNISLTHXQSGU-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/4691_1_3044_56_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Nitrophthalimide | 603-62-3 | 2A-9004683 |
| 3-Nitrophthalonitrile | 51762-67-5 | 2A-9004684 |
| 3-Nitropropiophenone | 17408-16-1 | 2A-9004685 |
| 3-Nitrovalerophenone | 80460-02-2 | 2A-9004687 |
| 3-Octadecyloxypropane-1,2-diol | 544-62-7 | 2A-9004688 |
| 3-Oxo-3-(2,3,6-trimethoxyphenyl)propionic acid methyl ester | 677326-66-8 | 2A-9004692 |
| 3-Oxo-3-(2,4,6-trimethylphenyl)propionic acid ethyl ester | 2A-104693 | 2A-9004693 |
| 3-Oxo-3-(2,4,6-trimethylphenyl)propionic acid methyl ester | 677326-72-6 | 2A-9004694 |
| 3-Oxo-3-(2-phenoxyphenyl)propionic acid ethyl ester | 2A-104695 | 2A-9004695 |
| 3-Oxo-3-(2-phenoxyphenyl)propionic acid methyl ester | 97541-70-3 | 2A-9004696 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS