![2-[4-Chloro-3-(chlorosulfonyl)benzoyl]benzoic acid structure, CAS 68592-12-1](/structures/60000/46847_2_68592_12_1.png)
CAS Number68592-12-1
Synonyms2-(4-chloro-3-chlorosulfonylbenzoyl)benzoic acid; 2-[4-Chloro-3-(chlorosulfonyl)benzoyl]benzoic acid; 2-(4-chlorosulfonyl)benzoyl)benzoicacid
Molecular FormulaC14H8Cl2O5S
Molecular Weight255.08
Purity99.00%
Density1.6±0.1 g/cm3
Boiling Point584.5±50.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 68592-12-1 |
| Catalog No. | 2A-9046847 |
| Chinese Name | 2-(3'-氯磺酰基-4'-氯苯甲酰)苯甲酸 |
| Synonyms | 2-(4-chloro-3-chlorosulfonylbenzoyl)benzoic acid; 2-[4-Chloro-3-(chlorosulfonyl)benzoyl]benzoic acid; 2-(4-chlorosulfonyl)benzoyl)benzoicacid |
| Molecular Formula | C14H8Cl2O5S |
| Molecular Weight | 255.08 |
| Purity | 99.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 584.5±50.0 °C at 760 mmHg |
| HTC | 2918300090 |
| PubChem ID | 10041757 |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C14H8Cl2O5S/c15-11-6-5-8(7-12(11)22(16,20)21)13(17)9-3-1-2-4-10(9)14(18)19/h1-7H,(H,18,19) |
| InChI Key | PYSORILUZXWKON-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tetradecyldimethylethylammonium bromide | 68527-84-4 | 2A-9046835 |
| Disuccinimidyl suberate | 68528-80-3 | 2A-9046836 |
| C13-C16 Isoparaffin | 68551-20-2 | 2A-9046838 |
| Polyquaternium-2 | 68555-36-2 | 2A-9046840 |
| Sodium lauryl ether sulfate | 68585-34-2 | 2A-9046845 |
| Cananga Oil | 68606-83-7 | 2A-9046849 |
| Petroleum sulfonic acids sodium salts | 68608-26-4 | 2A-9046850 |
| Octyl/decyl glycidyl ether | 68609-96-1 | 2A-9046852 |
| Alkyl (C12-C14) glycidyl ether | 68609-97-2 | 2A-9046853 |
| Poly(dicyclopentadiene-co-p-cresol) | 68610-51-5 | 2A-9046854 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA