
CAS Number68208-25-3
Synonyms3-Amino-3-(3-chlorophenyl)-1-propanol; 3-Amino-3-(3-chlorophenyl)propan-1-ol; 3-(3-Chlorphenyl)-3-aminopropanol; 3-Amino-3-(3-chlorophenyl)-propan-1-ol
Molecular FormulaC9H12O1N1Cl1
Molecular Weight185.65
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point327.9±27.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 68208-25-3 |
| Catalog No. | 2A-9046740 |
| Chinese Name | 3-氨基-3-间氯苯基-1-丙醇 |
| Synonyms | 3-Amino-3-(3-chlorophenyl)-1-propanol; 3-Amino-3-(3-chlorophenyl)propan-1-ol; 3-(3-Chlorphenyl)-3-aminopropanol; 3-Amino-3-(3-chlorophenyl)-propan-1-ol |
| Molecular Formula | C9H12O1N1Cl1 |
| Molecular Weight | 185.65 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 327.9±27.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2922199090 |
| PubChem ID | 7795989 |
| MDL Number | MFCD07784065 |
| InChI | InChI=1S/C9H12ClNO/c10-8-3-1-2-7(6-8)9(11)4-5-12/h1-3,6,9,12H,4-5,11H2 |
| InChI Key | YQMOQQKIRFWPQL-UHFFFAOYSA-N |
| MSDS | msds/46740_1_68208_25_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dodecylethyldimethylammonium bromide | 68207-00-1 | 2A-9046735 |
| 3-Amino-3-(4-methylphenyl)propionic acid | 68208-18-4 | 2A-9046736 |
| 3-Amino-3-(3-methoxyphenyl)propionic acid | 68208-19-5 | 2A-9046737 |
| 3-Amino-3-(2-chlorophenyl)propionic acid | 68208-20-8 | 2A-9046738 |
| 3-Amino-3-(3-methylphenyl)propan-1-ol | 68208-22-0 | 2A-9046739 |
| Cetyltrimethylammonium hydrogensulfate | 68214-07-3 | 2A-9046741 |
| Phenyl-2-aminobenzenesulfonate | 68227-69-0 | 2A-9046742 |
| Isosulfan Blue | 68238-36-8 | 2A-9046745 |
| 3-Aminophenol hemisulfate | 68239-81-6 | 2A-9046747 |
| 2-Nitro-1,4-benzenediamine sulfate | 68239-83-8 | 2A-9046748 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA