
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 68015-98-5 |
| Catalog No. | 2A-9046689 |
| Chinese Name | 2,4-二氨基苯乙醚硫酸盐 |
| Synonyms | 2,4-Diaminophenetole sulfate; EINECS 268-164-8; MFCD08460115 |
| Molecular Formula | C8H14N2O5S |
| Molecular Weight | 250.27200 |
| Purity | 98.00 |
| Boiling Point | 315.7ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2922299090 |
| PubChem ID | 23939347 |
| SMILES | CCOc1ccc(N)cc1N.O=S(=O)(O)O |
| InChI | InChI=1S/C8H12N2O.H2O4S/c1-2-11-8-4-3-6(9)5-7(8)10;1-5(2,3)4/h3-5H,2,9-10H2,1H3;(H2,1,2,3,4) |
| InChI Key | WRYXZLYZWDZVKS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dihydro-5-(4-methylphenyl)-3H-pyrazol-3-one | 66076-78-6 | 2A-9046377 |
| 2,4-Dichlorobutyrophenone | 66353-47-7 | 2A-9046417 |
| Fenoxaprop-ethyl | 66441-23-4 | 2A-9046428 |
| N-[(10-Oxido-9,10-dihydro-9-oxa-10-phosphaphenanthrene)methyl]-6-phenyl-1,3,5-triazine-2,4-diamine | 66560-05-2 | 2A-9046440 |
| cis-2-(2,4-Dichlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-ylmethyl methanesulphonate | 67914-86-7 | 2A-9046670 |
| Cyfluthrin | 68359-37-5 | 2A-9046775 |
| 2,4-Dimethyloxazole-5-carboxaldehyde | 69062-86-8 | 2A-9046967 |
| Glyphosate-diammonium | 69254-40-6 | 2A-9046989 |
| 5-Bromo-2,4-dimethylnitrobenzene | 69383-59-1 | 2A-9047010 |
| (2E,4E)-5-(4-Methoxy-2,3,6-trimethylphenyl)-3-methylpenta-2,4-dienal | 69877-38-9 | 2A-9047080 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA