
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 67827-72-9 |
| Catalog No. | 2A-9046643 |
| Chinese Name | 2-甲氧基-5-硝基苯胺盐酸盐 |
| Synonyms | EINECS 267-234-5; MFCD00060197; 2-methoxy-5-nitroaniline,hydrochloride |
| Molecular Formula | C7H9ClN2O3 |
| Molecular Weight | 168.15 |
| Purity | 97 |
| Boiling Point | 351.8ºC at 760 mmHg |
| Melting Point | 128-132 °C |
| Appearance | solid |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| Packaging | III |
| EINECS | 240-293-4 |
| HTC | 2922299090 |
| PubChem ID | 329763907 |
| MDL Number | MFCD00179573 |
| SMILES | COc1ccc(c(N)c1)[N+]([O-])=O |
| InChI | 1S/C7H8N2O3/c1-12-5-2-3-7(9(10)11)6(8)4-5/h2-4H,8H2,1H3 |
| InChI Key | QEHVRGACCVLLNN-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 6.1 |
| MSDS | msds/46643_1_67827_72_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzylisopropyl propionate | 67785-77-7 | 2A-9046631 |
| 2-Methoxy-4-morpholinobenzenediazonium chloride zinc chloride double salt | 67801-08-5 | 2A-9046633 |
| 8-Bromoquinolin-2(1H)-one | 67805-67-8 | 2A-9046635 |
| 2-Amino-4-chloro-6-nitrophenol hydrochloride | 67815-68-3 | 2A-9046641 |
| 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-alpha-D-galactopyranose | 67817-30-5 | 2A-9046642 |
| 4-Bromo-2-methylbenzonitrile | 67832-11-5 | 2A-9046645 |
| 2-Aminophenol hemisulfate | 67845-79-8 | 2A-9046647 |
| 2-Bromo-3-nitroanisole | 67853-37-6 | 2A-9046651 |
| Rhodium phosphate | 67859-71-6 | 2A-9046654 |
| Maltyl butyrate | 67860-01-9 | 2A-9046655 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA