
CAS Number67634-00-8
SynonymsMFCD03424212; prop-2-en-1-yl (3-methylbutoxy)acetate; Isoamyloxyacetic acid,allyl ester; Acetic acid, 2-(3-methylbutoxy)-, 2-propen-1-yl ester; Allyl isoamyl glycolate; Allyl (3-methylbutoxy)acetate; Glycolic acid 2-pentyloxy allyl ester; EINECS 266-803-5
Molecular FormulaC19H19NO4
Molecular Weight325.368
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point239.5±15.0 °C at 760 mmHg
Melting Point-23ºC
AppearanceTransparent colorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 67634-00-8 |
| Catalog No. | 2A-9046605 |
| Chinese Name | 格蓬酯 |
| Synonyms | MFCD03424212; prop-2-en-1-yl (3-methylbutoxy)acetate; Isoamyloxyacetic acid,allyl ester; Acetic acid, 2-(3-methylbutoxy)-, 2-propen-1-yl ester; Allyl isoamyl glycolate; Allyl (3-methylbutoxy)acetate; Glycolic acid 2-pentyloxy allyl ester; EINECS 266-803-5 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.368 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 239.5±15.0 °C at 760 mmHg |
| Melting Point | -23ºC |
| Appearance | Transparent colorless liquid |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| PubChem ID | 6281527 |
| MDL Number | MFCD01823267 |
| SMILES | C=CCOC(=O)COCCC(C)C |
| InChI | InChI=1S/C10H18O3/c1-4-6-13-10(11)8-12-7-5-9(2)3/h4,9H,1,5-8H2,2-3H3 |
| InChI Key | XCWPXUNHSPOFGV-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 4-hydroxynicotinate | 67367-24-2 | 2A-9046554 |
| 15,16-Dihydro-3-hydroxy-3'H-cycloprop[15,16]androsta-5,15-dien-17-one | 67372-65-0 | 2A-9046556 |
| Methyl 2-hydroxynicotinate | 67383-31-7 | 2A-9046559 |
| Indigotetrasulfonic acid tetrapotassium salt hydrate | 67627-19-4 | 2A-9046602 |
| 3-cis-Hexenyl methyl carbonate | 67633-96-9 | 2A-9046603 |
| Allyl (2-methylbutoxy)acetate | 67634-01-9 | 2A-9046606 |
| Florazone | 67634-15-5 | 2A-9046607 |
| Bromoacetic acid 1,4-butanediyl ester | 67638-54-4 | 2A-9046608 |
| 2,3,5-Trifluorobenzyl alcohol | 67640-33-9 | 2A-9046609 |
| 9,9'-Spirobi[9H-fluorene]-2,2'-diamine | 67665-45-6 | 2A-9046613 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA