
CAS Number65343-67-1
Synonyms2-(p-Hydroxyphenoxy)propionic acid ethyl ester; 2-(4-hydroxyphenoxy)propanoic acid ethyl ester; ethyl L-2-(4-hydroxyphenoxy)propionate; 2-(4-Hydroxyphenoxy)propionic acid ethyl ester; Ethyl (R)-(+)-2-(4-hydroxyphenoxy)propionate; ethyl 2-(p-hydroxyphenoxy)propionate; Propanoic acid, 2-(4-hydroxyphenoxy)-, ethyl ester; Ethyl 2-(4-hydroxyphenoxy)propanoate
Molecular FormulaC11H14O4
Molecular Weight210.23
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point327.4±17.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 65343-67-1 |
| Catalog No. | 2A-9046246 |
| Chinese Name | 2-(4-羟基苯氧基)丙酸乙酯 |
| Synonyms | 2-(p-Hydroxyphenoxy)propionic acid ethyl ester; 2-(4-hydroxyphenoxy)propanoic acid ethyl ester; ethyl L-2-(4-hydroxyphenoxy)propionate; 2-(4-Hydroxyphenoxy)propionic acid ethyl ester; Ethyl (R)-(+)-2-(4-hydroxyphenoxy)propionate; ethyl 2-(p-hydroxyphenoxy)propionate; Propanoic acid, 2-(4-hydroxyphenoxy)-, ethyl ester; Ethyl 2-(4-hydroxyphenoxy)propanoate |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 327.4±17.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918990090 |
| PubChem ID | 10041670 |
| MDL Number | MFCD23135279 |
| SMILES | CCOC(=O)C(C)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C11H14O4/c1-3-14-11(13)8(2)15-10-6-4-9(12)5-7-10/h4-8,12H,3H2,1-2H3 |
| InChI Key | ILYSHPJWNMPBPE-UHFFFAOYSA-N |
| MSDS | msds/46246_1_65343_67_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| Imidazo[1,2-a]pyridine-2-carboxylic acid | 64951-08-2 | 2A-9046169 |
| Imidazo[1,2-a]pyrimidine-2-carboxylic acid | 64951-10-6 | 2A-9046170 |
| (S)-1-[4-(2-Methylbutyl)phenyl]ethanone | 65134-00-1 | 2A-9046206 |
| (R)-(-)-6,6'-Dibromo-1,1'-bi-2-naphthol | 65283-60-5 | 2A-9046232 |
| (R)-(+)-Trityl glycidyl ether | 65291-30-7 | 2A-9046234 |
| (S)-(-)-5,5',6,6',7,7',8,8'-Octahydro-1,1'-bi-2-naphthol | 65355-00-2 | 2A-9046249 |
| N-Boc-N'-xanthyl-L-asparagine | 65420-40-8 | 2A-9046267 |
| (S)-1-(3,4-Dimethoxyphenyl)ethylamine | 65451-89-0 | 2A-9046276 |
| (S)-1-(Benzyloxycarbonyl)hexahydropyridazine-3-carboxylic acid | 65632-62-4 | 2A-9046300 |
| (R)-4-(1-Aminoethyl)benzenamine dihydrochloride | 65645-32-1 | 2A-9046301 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA