
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 65340-74-1 |
| Catalog No. | 2A-9046244 |
| Chinese Name | 4-氨基-7-溴喹啉 |
| Synonyms | 7-Bromo-4-quinolinamine; 7-bromoquinolin-4-amine; 4-Amino-7-bromoquinoline |
| Molecular Formula | C9H7BrN2 |
| Molecular Weight | 223.07 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 388.7±27.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, avoid light and dry |
| HTC | 2933499090 |
| PubChem ID | 4963786 |
| SMILES | Nc1ccnc2cc(Br)ccc12 |
| InChI | InChI=1S/C9H7BrN2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H,(H2,11,12) |
| InChI Key | CDROXEYPGVJRGK-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Amino-3-acetylpyridine | 65326-33-2 | 2A-9046239 |
| 2,5-Dimethyl-4-ethoxy-3(2H)-furanone | 65330-49-6 | 2A-9046240 |
| 6-Bromo-4-chloroquinoline | 65340-70-7 | 2A-9046241 |
| 8-Bromo-4-chloroquinoline | 65340-71-8 | 2A-9046242 |
| 4-Amino-6-bromoquinoline | 65340-73-0 | 2A-9046243 |
| 4-Amino-8-bromoquinoline | 65340-75-2 | 2A-9046245 |
| 3-(1,2,3,6-Tetrahydropyridin-4-yl)-1H-indole | 65347-55-9 | 2A-9046248 |
| 4-Chloro-2-nitropyridine | 65370-42-5 | 2A-9046257 |
| 2-Amino-5-chloro-4-methylbenzothiazole | 65373-18-4 | 2A-9046258 |
| Oxazole-2-carbaldehyde | 65373-52-6 | 2A-9046259 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA