
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55242-64-3 |
| Catalog No. | 2A-9004621 |
| Chinese Name | 3-甲基-7-丙基黄嘌呤 |
| Synonyms | MFCD02089337; 3-methyl-7-propylpurine-2,6-dione |
| Molecular Formula | C9H12O2N4 |
| Molecular Weight | 208.22 |
| Purity | 98 |
| Density | 1.44 g/cm3 |
| Melting Point | 104-109 °C |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | Room Temperature |
| HTC | 2933990090 |
| MDL Number | MFCD02089337 |
| SMILES | CCCn1cnc2c1c(=O)[nH]c(=O)n2C |
| InChI Key | MHNVSFOURBQRPK-UHFFFAOYSA-N |
| MSDS | msds/4621_1_55242_64_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Methyl-1-(3-nitrophenyl)-5-pyrazolone | 119-16-4 | 2A-9004608 |
| 3-Methyl-1,2-cyclopentanedione | 80-71-7 | 2A-9004609 |
| 3-Methyl-3-pyrazolin-5-one | 4344-87-0 | 2A-9004616 |
| 3-Methyl-4-nitrobenzylamine hydrochloride | 2A-104617 | 2A-9004617 |
| 3-Methyl-6-methylaminouracil | 5759-63-7 | 2A-9004619 |
| 3-Methylaminophenylpropanol | 916791-60-1 | 2A-9004622 |
| 3-Methylbiphenyl | 643-93-6 | 2A-9004625 |
| 3-Methyl-but-2-enoyl chloride | 3350-78-5 | 2A-9004627 |
| 3-Methyl-L-histidine | 332-80-9 | 2A-9004629 |
| 3-Methylsalicylic acid | 83-40-9 | 2A-9004632 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA