
CAS Number65085-83-8
SynonymsMFCD00173085; 1-[4-(phenylsulfonyl)phenyl]ethan-1-one; 1-(4-(benzenesulfonyl)phenyl)ethanone; 4-ACETYLDIPHENYL SUL; 1-[4-(PHENYLSULFONYL)PHENYL]-1-ETHANONE; 1-(4-(phenylsulfonyl)phenyl)ethanone; 4-Acetyldiphenylsulphone; ETHANONE,1-[4-(PHENYLSULFONYL)PHENYL]; 1-[4-(phenylsulphonyl)phenyl]ethan-1-one; 1-[4-(Phenylsulfonyl)phenyl]ethanone
Molecular FormulaC14H12O3S
Molecular Weight260.31
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point450.7±28.0 °C at 760 mmHg
Melting Point138-140°C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 65085-83-8 |
| Catalog No. | 2A-9046198 |
| Chinese Name | 4-乙酰联苯砜 |
| Synonyms | MFCD00173085; 1-[4-(phenylsulfonyl)phenyl]ethan-1-one; 1-(4-(benzenesulfonyl)phenyl)ethanone; 4-ACETYLDIPHENYL SUL; 1-[4-(PHENYLSULFONYL)PHENYL]-1-ETHANONE; 1-(4-(phenylsulfonyl)phenyl)ethanone; 4-Acetyldiphenylsulphone; ETHANONE,1-[4-(PHENYLSULFONYL)PHENYL]; 1-[4-(phenylsulphonyl)phenyl]ethan-1-one; 1-[4-(Phenylsulfonyl)phenyl]ethanone |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 450.7±28.0 °C at 760 mmHg |
| Melting Point | 138-140°C |
| Appearance | solid |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2914700090 |
| PubChem ID | 329778109 |
| MDL Number | MFCD00173085 |
| SMILES | CC(=O)c1ccc(cc1)S(=O)(=O)c2ccccc2 |
| InChI | 1S/C14H12O3S/c1-11(15)12-7-9-14(10-8-12)18(16,17)13-5-3-2-4-6-13/h2-10H,1H3 |
| InChI Key | FGFHDNIGKVTTLC-UHFFFAOYSA-N |
| UNSPSC | 12352200 |
| MSDS | msds/46198_1_65085_83_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Butyl-3-methylimidazolium iodide | 65039-05-6 | 2A-9046191 |
| 1-Ethyl-3-methylimidazolium bromide | 65039-08-9 | 2A-9046192 |
| 1-Ethyl-3-methylimidazolium chloride | 65039-09-0 | 2A-9046193 |
| Indeloxazine hydrochloride | 65043-22-3 | 2A-9046194 |
| 3-Chloro-4-fluorobenzoyl chloride | 65055-17-6 | 2A-9046196 |
| 2-Bromo-3-methoxypropionic acid | 65090-78-0 | 2A-9046199 |
| 4'-Bromo-2'-methylacetophenone | 65095-33-2 | 2A-9046201 |
| 3-(Diethoxymethylsilyl)propyl methacrylate | 65100-04-1 | 2A-9046202 |
| Dihydroxybis(ammonium lactato)titanium(IV) | 65104-06-5 | 2A-9046203 |
| 1-[4-(1H-Imidazol-1-yl)phenyl]methanamine | 65113-25-9 | 2A-9046204 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA