CAS Number64904-47-8
Synonymsbenzoyloxy acetaldehyde; BENZOYLOXY ACETALDEHYDE DIETHYL ACETAL; benzoyl glycolaldehyde; benzoic acid 2,2-diethoxyethyl ester; benzoic acid 2-oxo-ethyl ester; Acetaldehyde,2-(benzoyloxy); 2-benzoyloxy-acetaldehyde
Molecular FormulaCH3CH(OC2H5)2
Molecular Weight118.17
Purity98.00%
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 64904-47-8 |
| Catalog No. | 2A-9046162 |
| Chinese Name | 苯甲酰氧基乙醛缩二乙醇 |
| Synonyms | benzoyloxy acetaldehyde; BENZOYLOXY ACETALDEHYDE DIETHYL ACETAL; benzoyl glycolaldehyde; benzoic acid 2,2-diethoxyethyl ester; benzoic acid 2-oxo-ethyl ester; Acetaldehyde,2-(benzoyloxy); 2-benzoyloxy-acetaldehyde |
| Molecular Formula | CH3CH(OC2H5)2 |
| Molecular Weight | 118.17 |
| Purity | 98.00 |
| Storage Condition | -20°C, store in inert gas |
| HTC | 2916310090 |
| PubChem ID | 16933071 |
| SMILES | CCOC(COC(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C13H18O4/c1-3-15-12(16-4-2)10-17-13(14)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3 |
| InChI Key | QFKKHAZEIWDXRZ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,5-Dibromobenzene-1,4-dicarbaldehyde | 63525-48-4 | 2A-9045919 |
| 3-[2-Chloro-4-(trifluoromethyl)phenoxy]benzoic acid | 63734-62-3 | 2A-9045958 |
| 5-Norbornene-2-carboxylic tetrahydrofurfuryl ester | 64028-63-3 | 2A-9046011 |
| 2-Chloro-5-(trifluoromethyl)benzyl alcohol | 64372-62-9 | 2A-9046086 |
| 2-Butylcyclopropanecarboxylic acid methyl ester | 64583-94-4 | 2A-9046122 |
| N-Succinimidyl 4-(N-maleimidomethyl)cyclohexane-1-carboxylate | 64987-85-5 | 2A-9046182 |
| trans-4-Heptylcyclohexanecarboxylic acid | 65355-31-9 | 2A-9046252 |
| trans-4'-Propyl-(1,1'-bicyclohexyl)-4-carboxylic acid | 65355-32-0 | 2A-9046253 |
| trans-4'-Pentyl-(1,1'-bicyclohexyl)-4-carboxylic acid | 65355-33-1 | 2A-9046254 |
| (6a,11b,16a,17a)-6,9-Difluoro-11-hydroxy-16-methyl-3-oxo-17-(1-oxopropoxy)androsta-1,4-diene-17-carboxylic acid | 65429-42-7 | 2A-9046271 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS