
CAS Number64359-81-5
SynonymsEINECS 264-843-8; dcoit; MFCD04034673; 4,5-Dichloro-2-n-octyl-4-isothiazolin-3-one; 4,5-Dichloro-2-n-octyl-3(2H)-isothiazolone (DCOIT); 4,5-Dichloro-2-octyl-1,2-thiazol-3(2H)-one; 4,5-dichloro-2-octyl-1,2-thiazol-3-one; 4,5-Dichloro-2-octyl-isothiazolone
Molecular FormulaC11H17Cl2NOS
Molecular Weight282.230
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point322.6±52.0 °C at 760 mmHg
Melting Point36-40ºC
AppearanceTransparent to yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 64359-81-5 |
| Catalog No. | 2A-9046082 |
| Chinese Name | 4,5-二氯-N-辛基-4-异噻唑啉-3-酮 |
| Synonyms | EINECS 264-843-8; dcoit; MFCD04034673; 4,5-Dichloro-2-n-octyl-4-isothiazolin-3-one; 4,5-Dichloro-2-n-octyl-3(2H)-isothiazolone (DCOIT); 4,5-Dichloro-2-octyl-1,2-thiazol-3(2H)-one; 4,5-dichloro-2-octyl-1,2-thiazol-3-one; 4,5-Dichloro-2-octyl-isothiazolone |
| Molecular Formula | C11H17Cl2NOS |
| Molecular Weight | 282.230 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 322.6±52.0 °C at 760 mmHg |
| Melting Point | 36-40ºC |
| Appearance | Transparent to yellow liquid |
| Storage Condition | Room temperature, sealed, dry |
| Packaging | III |
| HTC | 2934999090 |
| PubChem ID | 10224973 |
| SMILES | CCCCCCCCn1sc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C11H17Cl2NOS/c1-2-3-4-5-6-7-8-14-11(15)9(12)10(13)16-14/h2-8H2,1H3 |
| InChI Key | PORQOHRXAJJKGK-UHFFFAOYSA-N |
| Hazard Symbols | Category 9 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Category 9 Miscellaneous UN number: 3077 Proper shipping name: Environmentally Hazardous Substance, Solid, Not otherwise specified Packing grade: III Marine pollutants: Y |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(4-Fluoro-3-methoxyphenyl)ethanone | 64287-19-0 | 2A-9046072 |
| 2-Iodylbenzoic acid | 64297-64-9 | 2A-9046073 |
| GCLH | 64308-63-0 | 2A-9046075 |
| 2-Amino-6-chloronicotinamide | 64321-24-0 | 2A-9046077 |
| 3-Fluoro-4-methylthiophenol | 64359-35-9 | 2A-9046081 |
| C13-C14 Isoparaffin | 64365-06-6 | 2A-9046084 |
| Tetramethyl(n-propyl)cyclopentadiene | 64417-12-5 | 2A-9046089 |
| Choline magnesium trisalicylate | 64425-90-7 | 2A-9046091 |
| 1,3-Bis[tris(hydroxymethyl)methylamino]propane | 64431-96-5 | 2A-9046092 |
| Tetrakis(acetonitrile)copper(I) hexafluorophosphate | 64443-05-6 | 2A-9046095 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA