
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 64234-14-6 |
| Catalog No. | 2A-9046053 |
| Chinese Name | (1R)-(-)-酮基蒎酸 |
| Synonyms | 7,7-dimethyl-2-oxo-norbornane-1-carboxylic acid |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.21600 |
| Purity | 98.00 |
| Density | 1.238 |
| HTC | 2918300090 |
| PubChem ID | 35414918 |
| SMILES | CC1(C)C2CCC1(C(=O)O)C(=O)C2 |
| InChI | InChI=1S/C10H14O3/c1-9(2)6-3-4-10(9,8(12)13)7(11)5-6/h6H,3-5H2,1-2H3,(H,12,13)/t6-,10+/m0/s1 |
| InChI Key | WDODWBQJVMBHCO-TYICEKJOSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Inhoffen Lythgoe diol | 64190-52-9 | 2A-9046038 |
| 3-Nitro-1,5-naphthyridin-2(1H)-one | 64222-33-9 | 2A-9046046 |
| Atracurium oxalate | 64228-78-0 | 2A-9046048 |
| Atracurium | 64228-79-1 | 2A-9046049 |
| Atracurium besylate | 64228-81-5 | 2A-9046050 |
| 2,3-Difluorobenzotrifluoride | 64248-59-5 | 2A-9046057 |
| 3,4-Difluorobenzonitrile | 64248-62-0 | 2A-9046059 |
| Fenpropathrin | 64257-84-7 | 2A-9046063 |
| N-tert-Butyloxycarbonyl-N-methyl-O-benzyl-L-threonine | 64263-80-5 | 2A-9046064 |
| 1,1-Dimethoxy-N,N-dimethyl-1-butanamine | 64277-22-1 | 2A-9046069 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA