
CAS Number64022-15-7
SynonymsNK Ester A-NP1E; 2-Propenoic acid,2-(2-naphthalenyloxy)ethyl ester; 2-Hydroxyethoxyb-naphthol acrylate; 2-(2-NAPHTHYLOXY)ETHYL ACRYLATE; 2-(2-Acryloyloxyethoxy)naphthalene; 2-(2-Naphthoxy)ethyl acrylate; 2-(1-NAPHTHYL)PIPERIDINE
Molecular FormulaCH2=C(CH2Br)CO2CH2CH3
Molecular Weight193.04
Purity98%
Density1.142 g/cm3
Boiling Point38 °C/0.8 mmHg (lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 64022-15-7 |
| Catalog No. | 2A-9046010 |
| Chinese Name | 丙烯酸 2-(2-萘氧基)乙酯 |
| Synonyms | NK Ester A-NP1E; 2-Propenoic acid,2-(2-naphthalenyloxy)ethyl ester; 2-Hydroxyethoxyb-naphthol acrylate; 2-(2-NAPHTHYLOXY)ETHYL ACRYLATE; 2-(2-Acryloyloxyethoxy)naphthalene; 2-(2-Naphthoxy)ethyl acrylate; 2-(1-NAPHTHYL)PIPERIDINE |
| Molecular Formula | CH2=C(CH2Br)CO2CH2CH3 |
| Molecular Weight | 193.04 |
| Purity | 98 |
| Density | 1.142 g/cm3 |
| Boiling Point | 38 °C/0.8 mmHg (lit.) |
| HTC | 2916129000 |
| PubChem ID | 24866620 |
| MDL Number | MFCD00031518 |
| SMILES | [H]\C([H])=C(\CBr)C(=O)OCC |
| InChI | 1S/C6H9BrO2/c1-3-9-6(8)5(2)4-7/h2-4H2,1H3 |
| InChI Key | MTCMFVTVXAOHNQ-UHFFFAOYSA-N |
| Beilstein/REAXYS | 970108 |
| NACRES Code | NA.23 |
| UNSPSC | 12162002 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Polymer Intermediates | ||
|---|---|---|
| 3-Methylhexahydrophthalic anhydride | 57110-29-9 | 2A-9044765 |
| Pentaerythritol tris[3-(1-aziridinyl)propionate] | 57116-45-7 | 2A-9044767 |
| Vinyl acetate-crotonic acid-vinyl neodecanoate terpolymer | 58748-38-2 | 2A-9045063 |
| Dipentaerythritol pentaacrylate | 60506-81-2 | 2A-9045344 |
| Ethoxylated-propoxylated Bisphenol A | 62611-29-4 | 2A-9045735 |
| Trimethylolpropane tris(2-methyl-1-aziridinepropionate) | 64265-57-2 | 2A-9046067 |
| Tetrabutylammonium periodate | 65201-77-6 | 2A-9046222 |
| Perfluoroalkylethyl acrylate | 65605-70-1 | 2A-0200245 |
| D-Sorbitol diglycidyl ether | 68412-01-1 | 2A-9046798 |
| C18-unsaturated fatty acids dimers polymers with diethylene glycol | 68552-01-2 | 2A-9046839 |
| Browse all Polymer Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA