CAS Number79822-46-1
Synonyms4-tert-butyl-3-methoxybenzoic acid; QVR CO1 DX1&1&1; 3-Methoxy-4-t-Butyl-Benzoicacid; 3-Methoxy-4-tert-butylbenzoic acid; 3-Methoxy-4-(2-methyl-2-propanyl)benzoic acid; 4-tert-Butyl-3-methoxy-benzoesaeure; 4-t-Butyl-3-methoxybenzoic acid; 3-Methoxy-4-t-butylbenzoic acid; MFCD06656116
Molecular FormulaC12H16O3
Molecular Weight208.254
Purity98%
Density1.1±0.1 g/cm3
Boiling Point334.7±35.0 °C at 760 mmHg
Melting Point150-152ºC
Appearancewhite solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79822-46-1 |
| Catalog No. | 2A-9004599 |
| Chinese Name | 3-甲氧基-4-叔丁基苯甲酸 |
| Synonyms | 4-tert-butyl-3-methoxybenzoic acid; QVR CO1 DX1&1&1; 3-Methoxy-4-t-Butyl-Benzoicacid; 3-Methoxy-4-tert-butylbenzoic acid; 3-Methoxy-4-(2-methyl-2-propanyl)benzoic acid; 4-tert-Butyl-3-methoxy-benzoesaeure; 4-t-Butyl-3-methoxybenzoic acid; 3-Methoxy-4-t-butylbenzoic acid; MFCD06656116 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.254 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 334.7±35.0 °C at 760 mmHg |
| Melting Point | 150-152ºC |
| Appearance | white solid |
| Storage Condition | Room temperature, dry |
| HTC | 2918990090 |
| SMILES | COc1cc(C(=O)O)ccc1C(C)(C)C |
| InChI Key | CSJQLIMNCLFPLZ-UHFFFAOYSA-N |
| MSDS | msds/4599_1_79822_46_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Mercaptopropyltriethoxysilane | 14814-09-6 | 2A-9004587 |
| 3-Methacryloxypropyltrimethoxysilane | 2530-85-0 | 2A-9004588 |
| 3-Methoxy-2-methyl-4-(1H)-pyridone | 2A-104592 | 2A-9004592 |
| 3-Methoxy-2-methylbenzoic acid | 55289-06-0 | 2A-9004593 |
| 3-Methoxy-4-nitrobenzoic acid | 5081-36-7 | 2A-9004597 |
| 3-Methoxybenzenthiol | 15570-12-4 | 2A-9004600 |
| 3-Methoxybenzonitrile | 1527-89-5 | 2A-9004601 |
| 3-Methoxybenzotrifluoride | 454-90-0 | 2A-9004602 |
| 3-Methoxybenzyl alcohol | 6971-51-3 | 2A-9004603 |
| 3-Methoxyphenylacetic acid | 1798-09-0 | 2A-9004604 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS