
CAS Number1201-26-9
Synonyms1-(1H-Indol-3-yl)acetone; 1-(1H-indol-3-yl)propan-2-one; Indol-3-yl-2-propanone; MFCD00047187; 1-(1H-Indol-3-yl)propan-2-on; 3-(2-oxopropyl)indole; EINECS 214-855-4; 3-Indolylacetone; Indole-3-acetone
Molecular FormulaC11H11NO
Molecular Weight173.211
Purity98%
Density1.2±0.1 g/cm3
Boiling Point341.7±17.0 °C at 760 mmHg
Melting Point115ºC ± 2ºC
AppearanceOff-white to light brown crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1201-26-9 |
| Catalog No. | 2A-9004575 |
| Chinese Name | 吲哚-3-丙酮 |
| Synonyms | 1-(1H-Indol-3-yl)acetone; 1-(1H-indol-3-yl)propan-2-one; Indol-3-yl-2-propanone; MFCD00047187; 1-(1H-Indol-3-yl)propan-2-on; 3-(2-oxopropyl)indole; EINECS 214-855-4; 3-Indolylacetone; Indole-3-acetone |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.211 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 341.7±17.0 °C at 760 mmHg |
| Melting Point | 115ºC ± 2ºC |
| Appearance | Off-white to light brown crystalline powder |
| Storage Condition | Sealed, stored at 2ºC -8ºC |
| SMILES | CC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H11NO/c1-8(13)6-9-7-12-11-5-3-2-4-10(9)11/h2-5,7,12H,6H2,1H3 |
| InChI Key | LDVHYJKRIKBISQ-UHFFFAOYSA-N |
| MSDS | msds/4575_1_1201_26_9.pdf |
| Transport Info | Product name: Indole-3-propanone |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 3-Chloro-2-methylphenyl isocyanate | 40397-90-8 | 2A-9004320 |
| 3-Chloro-4-fluorophenyl isothiocyanate | 137724-66-4 | 2A-9004343 |
| 3-Cyanophenyl isocyanate | 16413-26-6 | 2A-9004423 |
| 3-Cyclopentoxy-4-methoxyphenylisocyanate | 185300-51-0 | 2A-9004428 |
| 3H-Oxazolo[4,5-b]pyridin-2-one | 60832-72-6 | 2A-9004519 |
| 3-N-Boc-3-(2,3-dichlorophenyl)propionic acid | 284493-64-7 | 2A-9004645 |
| 3-N-Boc-3-(2-fluorophenyl)propionic acid | 284493-56-7 | 2A-9004646 |
| 3-N-Boc-3-(3,4-methylenedioxyphenyl)propionic acid | 149520-06-9 | 2A-9004647 |
| 3-N-Boc-3-(3-methoxyphenyl)propionic acid | 284493-53-4 | 2A-9004648 |
| 3-N-Boc-3-(3-nitrophenyl)propionic acid | 284492-22-4 | 2A-9004649 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA