
CAS Number62306-80-3
Synonyms(5-formylfuran-3-yl)boronic acid; (5-Formyl-2-furyl)boronic acid; 5-Formyl-2-furanylboronic acid; MFCD01319004; 2-formyl-4-furanboronic acid
Molecular FormulaC5H5BO4
Molecular Weight139.9
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point379.3±52.0 °C at 760 mmHg
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 62306-80-3 |
| Catalog No. | 2A-9045695 |
| Chinese Name | 5-醛基呋喃-3-硼酸 |
| Synonyms | (5-formylfuran-3-yl)boronic acid; (5-Formyl-2-furyl)boronic acid; 5-Formyl-2-furanylboronic acid; MFCD01319004; 2-formyl-4-furanboronic acid |
| Molecular Formula | C5H5BO4 |
| Molecular Weight | 139.9 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 379.3±52.0 °C at 760 mmHg |
| Appearance | White to light yellow crystal powder |
| Storage Condition | room temperature, sealed |
| HTC | 2932190090 |
| PubChem ID | 7769977 |
| SMILES | O=Cc1cc(B(O)O)co1 |
| InChI | InChI=1S/C5H5BO4/c7-2-5-1-4(3-10-5)6(8)9/h1-3,8-9H |
| InChI Key | RIBSTTPRQPAXRS-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Isopropyl-cyclohexanecarboxylic acid | 62067-45-2 | 2A-9045647 |
| 2-Methyl-3-trifluoromethylbenzoic acid | 62089-35-4 | 2A-9045652 |
| Cbz-beta-Amino-D-alanine | 62234-37-1 | 2A-9045677 |
| 1-(3-Trifluoromethylphenyl)-2-nitroethylene | 62248-94-6 | 2A-9045681 |
| Ethyl 3-(bromomethyl)benzoate | 62290-17-9 | 2A-9045690 |
| 4-Cyanophenyl trans-4-propylcyclohexanecarboxylate | 62439-33-2 | 2A-9045704 |
| 4-Cyanophenyl trans-4-pentylcyclohexanecarboxylate | 62439-35-4 | 2A-9045705 |
| 2-(4-Chlorophenyl)-2-cyanoacetaldehyde | 62538-21-0 | 2A-9045719 |
| 4'-[(2S)-2-Methylbutyl]-[1,1'-biphenyl]-4-carboxylic acid | 62614-48-6 | 2A-9045741 |
| Ethyl 3-pyridazinone-6-carboxylate | 63001-31-0 | 2A-9045809 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA